C16H27NO5 — CID 58248903
(2S,3S)-3-[(3R)-6,6,6-trideuterio-5-methyl-3-(3-methylbutylcarbamoyl)hexanoyl]oxirane-2-carboxylic acid (PubChem CID 58248903) has the molecular formula C16H27NO5 and a molecular weight of 316.41 g/mol. Its IUPAC name is (2S,3S)-3-[(3R)-6,6,6-trideuterio-5-methyl-3-(3-methylbutylcarbamoyl)hexanoyl]oxirane-2-carboxylic acid.
| Compound Name | (2S,3S)-3-[(3R)-6,6,6-trideuterio-5-methyl-3-(3-methylbutylcarbamoyl)hexanoyl]oxirane-2-carboxylic acid |
|---|---|
| PubChem CID | 58248903 |
| Molecular Formula | C16H27NO5 |
| Molecular Weight | 316.41 g/mol |
| Exact Mass | 316.21 |
| IUPAC Name | (2S,3S)-3-[(3R)-6,6,6-trideuterio-5-methyl-3-(3-methylbutylcarbamoyl)hexanoyl]oxirane-2-carboxylic acid |
| SMILES | [2H]C([2H])([2H])C(C)CC(CC(=O)[C@H]1O[C@@H]1C(=O)O)C(=O)NCCC(C)C |
| InChI | InChI=1S/C16H27NO5/c1-9(2)5-6-17-15(19)11(7-10(3)4)8-12(18)13-14(22-13)16(20)21/h9-11,13-14H,5-8H2,1-4H3,(H,17,19)(H,20,21)/t11?,13-,14+/m1/s1/i3D3/t10?,11?,13-,14+ |
| InChIKey | RKARWRJSRWDQEE-LSWNPUBMSA-N |
| XLogP | 1.62 |
| TPSA | 96.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.41 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|