C17H29NO4 — CID 58248912
(2R)-2-[2-[(2S,3S)-3-acetyloxiran-2-yl]-2-oxoethyl]-4-methyl-N-(1,1,2,2,3-pentadeuterio-3-methylbutyl)pentanamide (PubChem CID 58248912) has the molecular formula C17H29NO4 and a molecular weight of 316.45 g/mol. Its IUPAC name is (2R)-2-[2-[(2S,3S)-3-acetyloxiran-2-yl]-2-oxoethyl]-4-methyl-N-(1,1,2,2,3-pentadeuterio-3-methylbutyl)pentanamide.
| Compound Name | (2R)-2-[2-[(2S,3S)-3-acetyloxiran-2-yl]-2-oxoethyl]-4-methyl-N-(1,1,2,2,3-pentadeuterio-3-methylbutyl)pentanamide |
|---|---|
| PubChem CID | 58248912 |
| Molecular Formula | C17H29NO4 |
| Molecular Weight | 316.45 g/mol |
| Exact Mass | 316.24 |
| IUPAC Name | (2R)-2-[2-[(2S,3S)-3-acetyloxiran-2-yl]-2-oxoethyl]-4-methyl-N-(1,1,2,2,3-pentadeuterio-3-methylbutyl)pentanamide |
| SMILES | [2H]C(C)(C)C([2H])([2H])C([2H])([2H])NC(=O)[C@@H](CC(=O)[C@H]1O[C@@H]1C(C)=O)CC(C)C |
| InChI | InChI=1S/C17H29NO4/c1-10(2)6-7-18-17(21)13(8-11(3)4)9-14(20)16-15(22-16)12(5)19/h10-11,13,15-16H,6-9H2,1-5H3,(H,18,21)/t13-,15-,16-/m1/s1/i6D2,7D2,10D |
| InChIKey | JWQXLRVLCXRECN-YLCCPCHASA-N |
| XLogP | 2.13 |
| TPSA | 75.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.45 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|