C18H31NO5 — CID 58248931
ethyl (2S,3S)-3-[(3S)-3,4,4,5,6,6,6-heptadeuterio-5-methyl-3-(3-methylbutylcarbamoyl)hexanoyl]oxirane-2-carboxylate (PubChem CID 58248931) has the molecular formula C18H31NO5 and a molecular weight of 348.49 g/mol. Its IUPAC name is ethyl (2S,3S)-3-[(3S)-3,4,4,5,6,6,6-heptadeuterio-5-methyl-3-(3-methylbutylcarbamoyl)hexanoyl]oxirane-2-carboxylate.
| Compound Name | ethyl (2S,3S)-3-[(3S)-3,4,4,5,6,6,6-heptadeuterio-5-methyl-3-(3-methylbutylcarbamoyl)hexanoyl]oxirane-2-carboxylate |
|---|---|
| PubChem CID | 58248931 |
| Molecular Formula | C18H31NO5 |
| Molecular Weight | 348.49 g/mol |
| Exact Mass | 348.26 |
| IUPAC Name | ethyl (2S,3S)-3-[(3S)-3,4,4,5,6,6,6-heptadeuterio-5-methyl-3-(3-methylbutylcarbamoyl)hexanoyl]oxirane-2-carboxylate |
| SMILES | [2H]C([2H])([2H])C([2H])(C)C([2H])([2H])[C@@]([2H])(CC(=O)[C@H]1O[C@@H]1C(=O)OCC)C(=O)NCCC(C)C |
| InChI | InChI=1S/C18H31NO5/c1-6-23-18(22)16-15(24-16)14(20)10-13(9-12(4)5)17(21)19-8-7-11(2)3/h11-13,15-16H,6-10H2,1-5H3,(H,19,21)/t13-,15+,16-/m0/s1/i4D3,9D2,12D,13D/t12?,13-,15+,16- |
| InChIKey | OUCQQJZYANVOCY-XRWBQJGBSA-N |
| XLogP | 2.10 |
| TPSA | 85.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.49 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|