C8H10O — CID 58249024
1,1,4,4-tetradeuterioocta-2,5-diyn-1-ol (PubChem CID 58249024) has the molecular formula C8H10O and a molecular weight of 126.19 g/mol. Its IUPAC name is 1,1,4,4-tetradeuterioocta-2,5-diyn-1-ol.
| Compound Name | 1,1,4,4-tetradeuterioocta-2,5-diyn-1-ol |
|---|---|
| PubChem CID | 58249024 |
| Molecular Formula | C8H10O |
| Molecular Weight | 126.19 g/mol |
| Exact Mass | 126.10 |
| IUPAC Name | 1,1,4,4-tetradeuterioocta-2,5-diyn-1-ol |
| SMILES | [2H]C([2H])(O)C#CC([2H])([2H])C#CCC |
| InChI | InChI=1S/C8H10O/c1-2-3-4-5-6-7-8-9/h9H,2,5,8H2,1H3/i5D2,8D2 |
| InChIKey | TXUHNLOXWCWCHH-CNVQUGECSA-N |
| XLogP | 0.79 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 126.19 |
| LogP ≤ 5 | 0.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|