C11H18O5 — CID 58249232
(2R)-2-(3-ethoxy-2-oxopropyl)-5-oxohexanoic acid (PubChem CID 58249232) has the molecular formula C11H18O5 and a molecular weight of 230.26 g/mol. Its IUPAC name is (2R)-2-(3-ethoxy-2-oxopropyl)-5-oxohexanoic acid.
| Compound Name | (2R)-2-(3-ethoxy-2-oxopropyl)-5-oxohexanoic acid |
|---|---|
| PubChem CID | 58249232 |
| Molecular Formula | C11H18O5 |
| Molecular Weight | 230.26 g/mol |
| Exact Mass | 230.12 |
| IUPAC Name | (2R)-2-(3-ethoxy-2-oxopropyl)-5-oxohexanoic acid |
| SMILES | CCOCC(=O)CC(CCC(C)=O)C(=O)O |
| InChI | InChI=1S/C11H18O5/c1-3-16-7-10(13)6-9(11(14)15)5-4-8(2)12/h9H,3-7H2,1-2H3,(H,14,15) |
| InChIKey | JMDQFALEWZDVLQ-UHFFFAOYSA-N |
| XLogP | 1.05 |
| TPSA | 80.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.26 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |