C33H24N4OSi — CID 58249906
7-(6-phenyl-2-pyridinyl)-6,6-dipyridin-3-ylbenzo[d][1,3,2]benzoxazasilepine (PubChem CID 58249906) has the molecular formula C33H24N4OSi and a molecular weight of 520.67 g/mol. Its IUPAC name is 7-(6-phenyl-2-pyridinyl)-6,6-dipyridin-3-ylbenzo[d][1,3,2]benzoxazasilepine.
| Compound Name | 7-(6-phenyl-2-pyridinyl)-6,6-dipyridin-3-ylbenzo[d][1,3,2]benzoxazasilepine |
|---|---|
| PubChem CID | 58249906 |
| Molecular Formula | C33H24N4OSi |
| Molecular Weight | 520.67 g/mol |
| Exact Mass | 520.17 |
| IUPAC Name | 7-(6-phenyl-2-pyridinyl)-6,6-dipyridin-3-ylbenzo[d][1,3,2]benzoxazasilepine |
| SMILES | c1ccc(-c2cccc(N3c4ccccc4-c4ccccc4O[Si]3(c3cccnc3)c3cccnc3)n2)cc1 |
| InChI | InChI=1S/C33H24N4OSi/c1-2-11-25(12-3-1)30-17-8-20-33(36-30)37-31-18-6-4-15-28(31)29-16-5-7-19-32(29)38-39(37,26-13-9-21-34-23-26)27-14-10-22-35-24-27/h1-24H |
| InChIKey | KCGHYYBMSWBWLO-UHFFFAOYSA-N |
| XLogP | 5.99 |
| TPSA | 51.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.67 |
| LogP ≤ 5 | 5.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|