C28H27NOSi — CID 58249934
5,6-dimethyl-2,2-bis(4-methylphenyl)-3-phenyl-1,3,2-benzoxazasilole (PubChem CID 58249934) has the molecular formula C28H27NOSi and a molecular weight of 421.62 g/mol. Its IUPAC name is 5,6-dimethyl-2,2-bis(4-methylphenyl)-3-phenyl-1,3,2-benzoxazasilole.
| Compound Name | 5,6-dimethyl-2,2-bis(4-methylphenyl)-3-phenyl-1,3,2-benzoxazasilole |
|---|---|
| PubChem CID | 58249934 |
| Molecular Formula | C28H27NOSi |
| Molecular Weight | 421.62 g/mol |
| Exact Mass | 421.19 |
| IUPAC Name | 5,6-dimethyl-2,2-bis(4-methylphenyl)-3-phenyl-1,3,2-benzoxazasilole |
| SMILES | Cc1ccc([Si]2(c3ccc(C)cc3)Oc3cc(C)c(C)cc3N2c2ccccc2)cc1 |
| InChI | InChI=1S/C28H27NOSi/c1-20-10-14-25(15-11-20)31(26-16-12-21(2)13-17-26)29(24-8-6-5-7-9-24)27-18-22(3)23(4)19-28(27)30-31/h5-19H,1-4H3 |
| InChIKey | DTBLMWUJPCVRRJ-UHFFFAOYSA-N |
| XLogP | 5.71 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.62 |
| LogP ≤ 5 | 5.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|