C16H12N4Si — CID 58250031
7,7'-spirobi[6,8-diaza-7-silatricyclo[6.3.0.02,6]undeca-1(11),2,4,9-tetraene] (PubChem CID 58250031) has the molecular formula C16H12N4Si and a molecular weight of 288.39 g/mol. Its IUPAC name is 7,7'-spirobi[6,8-diaza-7-silatricyclo[6.3.0.02,6]undeca-1(11),2,4,9-tetraene].
| Compound Name | 7,7'-spirobi[6,8-diaza-7-silatricyclo[6.3.0.02,6]undeca-1(11),2,4,9-tetraene] |
|---|---|
| PubChem CID | 58250031 |
| Molecular Formula | C16H12N4Si |
| Molecular Weight | 288.39 g/mol |
| Exact Mass | 288.08 |
| IUPAC Name | 7,7'-spirobi[6,8-diaza-7-silatricyclo[6.3.0.02,6]undeca-1(11),2,4,9-tetraene] |
| SMILES | c1cc2n(c1)[Si]1(n3cccc3-2)n2cccc2-c2cccn21 |
| InChI | InChI=1S/C16H12N4Si/c1-5-13-14-6-2-10-18(14)21(17(13)9-1)19-11-3-7-15(19)16-8-4-12-20(16)21/h1-12H |
| InChIKey | JZSUKXHQKGZVHC-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 19.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.39 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|