About bis(2-pyrrol-1-id-2-ylpyrrol-1-ide);titanium(4+)
bis(2-pyrrol-1-id-2-ylpyrrol-1-ide);titanium(4+) (PubChem CID 58250069) has the molecular formula C16H12N4Ti
and a molecular weight of 308.17 g/mol. Its IUPAC name is bis(2-pyrrol-1-id-2-ylpyrrol-1-ide);titanium(4+).
Molecular Properties
| Compound Name | bis(2-pyrrol-1-id-2-ylpyrrol-1-ide);titanium(4+) |
| PubChem CID | 58250069 |
| Molecular Formula | C16H12N4Ti |
| Molecular Weight | 308.17 g/mol |
| Exact Mass | 308.05 |
| IUPAC Name | bis(2-pyrrol-1-id-2-ylpyrrol-1-ide);titanium(4+) |
| SMILES | [Ti+4].c1c[n-]c(-c2ccc[n-]2)c1.c1c[n-]c(-c2ccc[n-]2)c1 |
| InChI | InChI=1S/2C8H6N2.Ti/c2*1-3-7(9-5-1)8-4-2-6-10-8;/h2*1-6H;/q2*-2;+4 |
| InChIKey | MVDLFUZAEIHGAX-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 56.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 308.17 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze bis(2-pyrrol-1-id-2-ylpyrrol-1-ide);titanium(4+) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis(2-pyrrol-1-id-2-ylpyrrol-1-ide);titanium(4+)?
The IUPAC name of bis(2-pyrrol-1-id-2-ylpyrrol-1-ide);titanium(4+) (CID 58250069) is bis(2-pyrrol-1-id-2-ylpyrrol-1-ide);titanium(4+).
What is the SMILES notation for bis(2-pyrrol-1-id-2-ylpyrrol-1-ide);titanium(4+)?
The canonical SMILES for bis(2-pyrrol-1-id-2-ylpyrrol-1-ide);titanium(4+) is [Ti+4].c1c[n-]c(-c2ccc[n-]2)c1.c1c[n-]c(-c2ccc[n-]2)c1.
What is the InChIKey of bis(2-pyrrol-1-id-2-ylpyrrol-1-ide);titanium(4+)?
The InChIKey is MVDLFUZAEIHGAX-UHFFFAOYSA-N. The full InChI is InChI=1S/2C8H6N2.Ti/c2*1-3-7(9-5-1)8-4-2-6-10-8;/h2*1-6H;/q2*-2;+4.
What are the key properties of bis(2-pyrrol-1-id-2-ylpyrrol-1-ide);titanium(4+)?
bis(2-pyrrol-1-id-2-ylpyrrol-1-ide);titanium(4+) has a molecular weight of 308.17 g/mol, XLogP of 2.53, 2 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for bis(2-pyrrol-1-id-2-ylpyrrol-1-ide);titanium(4+) is sourced from PubChem (CID 58250069), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).