C20H12N4O2 — CID 58250257
3-(1H-imidazo[4,5-f][1,10]phenanthrolin-2-yl)benzoic acid (PubChem CID 58250257) has the molecular formula C20H12N4O2 and a molecular weight of 340.34 g/mol. Its IUPAC name is 3-(1H-imidazo[4,5-f][1,10]phenanthrolin-2-yl)benzoic acid.
| Compound Name | 3-(1H-imidazo[4,5-f][1,10]phenanthrolin-2-yl)benzoic acid |
|---|---|
| PubChem CID | 58250257 |
| Molecular Formula | C20H12N4O2 |
| Molecular Weight | 340.34 g/mol |
| Exact Mass | 340.10 |
| IUPAC Name | 3-(1H-imidazo[4,5-f][1,10]phenanthrolin-2-yl)benzoic acid |
| SMILES | O=C(O)c1cccc(-c2nc3c4cccnc4c4ncccc4c3[nH]2)c1 |
| InChI | InChI=1S/C20H12N4O2/c25-20(26)12-5-1-4-11(10-12)19-23-17-13-6-2-8-21-15(13)16-14(18(17)24-19)7-3-9-22-16/h1-10H,(H,23,24)(H,25,26) |
| InChIKey | ADIZZYWXVGEPDB-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 91.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.34 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|