C45H54N6 — CID 58250514
1-[4,6-bis(2,3,4,5,6,7-hexamethylindol-1-yl)-1,3,5-triazin-2-yl]-2,3,4,5,6,7-hexamethylindole (PubChem CID 58250514) has the molecular formula C45H54N6 and a molecular weight of 678.97 g/mol. Its IUPAC name is 1-[4,6-bis(2,3,4,5,6,7-hexamethylindol-1-yl)-1,3,5-triazin-2-yl]-2,3,4,5,6,7-hexamethylindole.
| Compound Name | 1-[4,6-bis(2,3,4,5,6,7-hexamethylindol-1-yl)-1,3,5-triazin-2-yl]-2,3,4,5,6,7-hexamethylindole |
|---|---|
| PubChem CID | 58250514 |
| Molecular Formula | C45H54N6 |
| Molecular Weight | 678.97 g/mol |
| Exact Mass | 678.44 |
| IUPAC Name | 1-[4,6-bis(2,3,4,5,6,7-hexamethylindol-1-yl)-1,3,5-triazin-2-yl]-2,3,4,5,6,7-hexamethylindole |
| SMILES | Cc1c(C)c(C)c2c(c1C)c(C)c(C)n2-c1nc(-n2c(C)c(C)c3c(C)c(C)c(C)c(C)c32)nc(-n2c(C)c(C)c3c(C)c(C)c(C)c(C)c32)n1 |
| InChI | InChI=1S/C45H54N6/c1-19-22(4)28(10)40-37(25(19)7)31(13)34(16)49(40)43-46-44(50-35(17)32(14)38-26(8)20(2)23(5)29(11)41(38)50)48-45(47-43)51-36(18)33(15)39-27(9)21(3)24(6)30(12)42(39)51/h1-18H3 |
| InChIKey | STXKPENJIISLBR-UHFFFAOYSA-N |
| XLogP | 11.25 |
| TPSA | 53.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 678.97 |
| LogP ≤ 5 | 11.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |