About 3,6-bis(4-methyl-2,6-dipropylphenyl)pyridazine
3,6-bis(4-methyl-2,6-dipropylphenyl)pyridazine (PubChem CID 58250587) has the molecular formula C30H40N2
and a molecular weight of 428.66 g/mol. Its IUPAC name is 3,6-bis(4-methyl-2,6-dipropylphenyl)pyridazine.
Molecular Properties
| Compound Name | 3,6-bis(4-methyl-2,6-dipropylphenyl)pyridazine |
| PubChem CID | 58250587 |
| Molecular Formula | C30H40N2 |
| Molecular Weight | 428.66 g/mol |
| Exact Mass | 428.32 |
| IUPAC Name | 3,6-bis(4-methyl-2,6-dipropylphenyl)pyridazine |
| SMILES | CCCc1cc(C)cc(CCC)c1-c1ccc(-c2c(CCC)cc(C)cc2CCC)nn1 |
| InChI | InChI=1S/C30H40N2/c1-7-11-23-17-21(5)18-24(12-8-2)29(23)27-15-16-28(32-31-27)30-25(13-9-3)19-22(6)20-26(30)14-10-4/h15-20H,7-14H2,1-6H3 |
| InChIKey | BLPMBXGKDMSIED-UHFFFAOYSA-N |
| XLogP | 8.24 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 428.66 |
| LogP ≤ 5 | 8.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3,6-bis(4-methyl-2,6-dipropylphenyl)pyridazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,6-bis(4-methyl-2,6-dipropylphenyl)pyridazine?
The IUPAC name of 3,6-bis(4-methyl-2,6-dipropylphenyl)pyridazine (CID 58250587) is 3,6-bis(4-methyl-2,6-dipropylphenyl)pyridazine.
What is the SMILES notation for 3,6-bis(4-methyl-2,6-dipropylphenyl)pyridazine?
The canonical SMILES for 3,6-bis(4-methyl-2,6-dipropylphenyl)pyridazine is CCCc1cc(C)cc(CCC)c1-c1ccc(-c2c(CCC)cc(C)cc2CCC)nn1.
What is the InChIKey of 3,6-bis(4-methyl-2,6-dipropylphenyl)pyridazine?
The InChIKey is BLPMBXGKDMSIED-UHFFFAOYSA-N. The full InChI is InChI=1S/C30H40N2/c1-7-11-23-17-21(5)18-24(12-8-2)29(23)27-15-16-28(32-31-27)30-25(13-9-3)19-22(6)20-26(30)14-10-4/h15-20H,7-14H2,1-6H3.
What are the key properties of 3,6-bis(4-methyl-2,6-dipropylphenyl)pyridazine?
3,6-bis(4-methyl-2,6-dipropylphenyl)pyridazine has a molecular weight of 428.66 g/mol, XLogP of 8.24, 10 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3,6-bis(4-methyl-2,6-dipropylphenyl)pyridazine is sourced from PubChem (CID 58250587), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).