About 2,5-bis(5-methyl-4-propylpyrimidin-2-yl)-3,6-dipropylpyrazine
2,5-bis(5-methyl-4-propylpyrimidin-2-yl)-3,6-dipropylpyrazine (PubChem CID 58250607) has the molecular formula C26H36N6
and a molecular weight of 432.62 g/mol. Its IUPAC name is 2,5-bis(5-methyl-4-propylpyrimidin-2-yl)-3,6-dipropylpyrazine.
Molecular Properties
| Compound Name | 2,5-bis(5-methyl-4-propylpyrimidin-2-yl)-3,6-dipropylpyrazine |
| PubChem CID | 58250607 |
| Molecular Formula | C26H36N6 |
| Molecular Weight | 432.62 g/mol |
| Exact Mass | 432.30 |
| IUPAC Name | 2,5-bis(5-methyl-4-propylpyrimidin-2-yl)-3,6-dipropylpyrazine |
| SMILES | CCCc1nc(-c2nc(CCC)c(-c3ncc(C)c(CCC)n3)nc2CCC)ncc1C |
| InChI | InChI=1S/C26H36N6/c1-7-11-19-17(5)15-27-25(31-19)23-21(13-9-3)30-24(22(29-23)14-10-4)26-28-16-18(6)20(32-26)12-8-2/h15-16H,7-14H2,1-6H3 |
| InChIKey | WHTJQNDPUVSJHY-UHFFFAOYSA-N |
| XLogP | 5.82 |
| TPSA | 77.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 432.62 |
| LogP ≤ 5 | 5.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 2,5-bis(5-methyl-4-propylpyrimidin-2-yl)-3,6-dipropylpyrazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,5-bis(5-methyl-4-propylpyrimidin-2-yl)-3,6-dipropylpyrazine?
The IUPAC name of 2,5-bis(5-methyl-4-propylpyrimidin-2-yl)-3,6-dipropylpyrazine (CID 58250607) is 2,5-bis(5-methyl-4-propylpyrimidin-2-yl)-3,6-dipropylpyrazine.
What is the SMILES notation for 2,5-bis(5-methyl-4-propylpyrimidin-2-yl)-3,6-dipropylpyrazine?
The canonical SMILES for 2,5-bis(5-methyl-4-propylpyrimidin-2-yl)-3,6-dipropylpyrazine is CCCc1nc(-c2nc(CCC)c(-c3ncc(C)c(CCC)n3)nc2CCC)ncc1C.
What is the InChIKey of 2,5-bis(5-methyl-4-propylpyrimidin-2-yl)-3,6-dipropylpyrazine?
The InChIKey is WHTJQNDPUVSJHY-UHFFFAOYSA-N. The full InChI is InChI=1S/C26H36N6/c1-7-11-19-17(5)15-27-25(31-19)23-21(13-9-3)30-24(22(29-23)14-10-4)26-28-16-18(6)20(32-26)12-8-2/h15-16H,7-14H2,1-6H3.
What are the key properties of 2,5-bis(5-methyl-4-propylpyrimidin-2-yl)-3,6-dipropylpyrazine?
2,5-bis(5-methyl-4-propylpyrimidin-2-yl)-3,6-dipropylpyrazine has a molecular weight of 432.62 g/mol, XLogP of 5.82, 10 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2,5-bis(5-methyl-4-propylpyrimidin-2-yl)-3,6-dipropylpyrazine is sourced from PubChem (CID 58250607), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).