C20H24N6 — CID 58250609
2,5-dimethyl-3,6-bis(4,5,6-trimethylpyrimidin-2-yl)pyrazine (PubChem CID 58250609) has the molecular formula C20H24N6 and a molecular weight of 348.45 g/mol. Its IUPAC name is 2,5-dimethyl-3,6-bis(4,5,6-trimethylpyrimidin-2-yl)pyrazine.
| Compound Name | 2,5-dimethyl-3,6-bis(4,5,6-trimethylpyrimidin-2-yl)pyrazine |
|---|---|
| PubChem CID | 58250609 |
| Molecular Formula | C20H24N6 |
| Molecular Weight | 348.45 g/mol |
| Exact Mass | 348.21 |
| IUPAC Name | 2,5-dimethyl-3,6-bis(4,5,6-trimethylpyrimidin-2-yl)pyrazine |
| SMILES | Cc1nc(-c2nc(C)c(C)c(C)n2)c(C)nc1-c1nc(C)c(C)c(C)n1 |
| InChI | InChI=1S/C20H24N6/c1-9-11(3)23-19(24-12(9)4)17-15(7)22-18(16(8)21-17)20-25-13(5)10(2)14(6)26-20/h1-8H3 |
| InChIKey | WJAIQYIKOVTBOU-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 77.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.45 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |