C34H46N8 — CID 58250635
2,4,6-tris(3,6-dipropylpyrazin-2-yl)pyrimidine (PubChem CID 58250635) has the molecular formula C34H46N8 and a molecular weight of 566.80 g/mol. Its IUPAC name is 2,4,6-tris(3,6-dipropylpyrazin-2-yl)pyrimidine.
| Compound Name | 2,4,6-tris(3,6-dipropylpyrazin-2-yl)pyrimidine |
|---|---|
| PubChem CID | 58250635 |
| Molecular Formula | C34H46N8 |
| Molecular Weight | 566.80 g/mol |
| Exact Mass | 566.38 |
| IUPAC Name | 2,4,6-tris(3,6-dipropylpyrazin-2-yl)pyrimidine |
| SMILES | CCCc1cnc(CCC)c(-c2cc(-c3nc(CCC)cnc3CCC)nc(-c3nc(CCC)cnc3CCC)n2)n1 |
| InChI | InChI=1S/C34H46N8/c1-7-13-23-20-35-26(16-10-4)31(38-23)29-19-30(32-27(17-11-5)36-21-24(39-32)14-8-2)42-34(41-29)33-28(18-12-6)37-22-25(40-33)15-9-3/h19-22H,7-18H2,1-6H3 |
| InChIKey | WIYPPCAKUGHZPP-UHFFFAOYSA-N |
| XLogP | 7.56 |
| TPSA | 103.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.80 |
| LogP ≤ 5 | 7.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |