About 2,5-bis(5-methylpyrimidin-2-yl)-3,6-dipropylpyrazine
2,5-bis(5-methylpyrimidin-2-yl)-3,6-dipropylpyrazine (PubChem CID 58250667) has the molecular formula C20H24N6
and a molecular weight of 348.45 g/mol. Its IUPAC name is 2,5-bis(5-methylpyrimidin-2-yl)-3,6-dipropylpyrazine.
Molecular Properties
| Compound Name | 2,5-bis(5-methylpyrimidin-2-yl)-3,6-dipropylpyrazine |
| PubChem CID | 58250667 |
| Molecular Formula | C20H24N6 |
| Molecular Weight | 348.45 g/mol |
| Exact Mass | 348.21 |
| IUPAC Name | 2,5-bis(5-methylpyrimidin-2-yl)-3,6-dipropylpyrazine |
| SMILES | CCCc1nc(-c2ncc(C)cn2)c(CCC)nc1-c1ncc(C)cn1 |
| InChI | InChI=1S/C20H24N6/c1-5-7-15-17(19-21-9-13(3)10-22-19)26-16(8-6-2)18(25-15)20-23-11-14(4)12-24-20/h9-12H,5-8H2,1-4H3 |
| InChIKey | BPVFOOLDXKRPNG-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 77.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 348.45 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 2,5-bis(5-methylpyrimidin-2-yl)-3,6-dipropylpyrazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,5-bis(5-methylpyrimidin-2-yl)-3,6-dipropylpyrazine?
The IUPAC name of 2,5-bis(5-methylpyrimidin-2-yl)-3,6-dipropylpyrazine (CID 58250667) is 2,5-bis(5-methylpyrimidin-2-yl)-3,6-dipropylpyrazine.
What is the SMILES notation for 2,5-bis(5-methylpyrimidin-2-yl)-3,6-dipropylpyrazine?
The canonical SMILES for 2,5-bis(5-methylpyrimidin-2-yl)-3,6-dipropylpyrazine is CCCc1nc(-c2ncc(C)cn2)c(CCC)nc1-c1ncc(C)cn1.
What is the InChIKey of 2,5-bis(5-methylpyrimidin-2-yl)-3,6-dipropylpyrazine?
The InChIKey is BPVFOOLDXKRPNG-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H24N6/c1-5-7-15-17(19-21-9-13(3)10-22-19)26-16(8-6-2)18(25-15)20-23-11-14(4)12-24-20/h9-12H,5-8H2,1-4H3.
What are the key properties of 2,5-bis(5-methylpyrimidin-2-yl)-3,6-dipropylpyrazine?
2,5-bis(5-methylpyrimidin-2-yl)-3,6-dipropylpyrazine has a molecular weight of 348.45 g/mol, XLogP of 3.91, 6 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2,5-bis(5-methylpyrimidin-2-yl)-3,6-dipropylpyrazine is sourced from PubChem (CID 58250667), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).