C48H48N6 — CID 58250694
2,4,6-tris[5-(4-tert-butylphenyl)-2-pyridinyl]-1,3,5-triazine (PubChem CID 58250694) has the molecular formula C48H48N6 and a molecular weight of 708.95 g/mol. Its IUPAC name is 2,4,6-tris[5-(4-tert-butylphenyl)-2-pyridinyl]-1,3,5-triazine.
| Compound Name | 2,4,6-tris[5-(4-tert-butylphenyl)-2-pyridinyl]-1,3,5-triazine |
|---|---|
| PubChem CID | 58250694 |
| Molecular Formula | C48H48N6 |
| Molecular Weight | 708.95 g/mol |
| Exact Mass | 708.39 |
| IUPAC Name | 2,4,6-tris[5-(4-tert-butylphenyl)-2-pyridinyl]-1,3,5-triazine |
| SMILES | CC(C)(C)c1ccc(-c2ccc(-c3nc(-c4ccc(-c5ccc(C(C)(C)C)cc5)cn4)nc(-c4ccc(-c5ccc(C(C)(C)C)cc5)cn4)n3)nc2)cc1 |
| InChI | InChI=1S/C48H48N6/c1-46(2,3)37-19-10-31(11-20-37)34-16-25-40(49-28-34)43-52-44(41-26-17-35(29-50-41)32-12-21-38(22-13-32)47(4,5)6)54-45(53-43)42-27-18-36(30-51-42)33-14-23-39(24-15-33)48(7,8)9/h10-30H,1-9H3 |
| InChIKey | LWWDDVYLTVHBGT-UHFFFAOYSA-N |
| XLogP | 11.95 |
| TPSA | 77.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 708.95 |
| LogP ≤ 5 | 11.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |