About CID 58250758
CID 58250758 (PubChem CID 58250758) has the molecular formula C41H37F2NO2Si
and a molecular weight of 641.83 g/mol.
Molecular Properties
| Compound Name | CID 58250758 |
| PubChem CID | 58250758 |
| Molecular Formula | C41H37F2NO2Si |
| Molecular Weight | 641.83 g/mol |
| Exact Mass | 641.26 |
| IUPAC Name | — |
| SMILES | C[Si]OCC1CCCN(c2ccc(C3(c4ccccc4)C=Cc4c5c(c6ccc(F)cc6c4O3)-c3ccc(F)cc3C5(C)C)cc2)C1 |
| InChI | InChI=1S/C41H37F2NO2Si/c1-40(2)36-23-30(43)14-18-33(36)37-32-17-13-29(42)22-35(32)39-34(38(37)40)19-20-41(46-39,27-9-5-4-6-10-27)28-11-15-31(16-12-28)44-21-7-8-26(24-44)25-45-47-3/h4-6,9-20,22-23,26H,7-8,21,24-25H2,1-3H3 |
| InChIKey | XKAWJDRXGNYTRE-UHFFFAOYSA-N |
| XLogP | 9.67 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 47 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 641.83 |
| LogP ≤ 5 | 9.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 58250758 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 58250758?
The IUPAC name of CID 58250758 (CID 58250758) is not available.
What is the SMILES notation for CID 58250758?
The canonical SMILES for CID 58250758 is C[Si]OCC1CCCN(c2ccc(C3(c4ccccc4)C=Cc4c5c(c6ccc(F)cc6c4O3)-c3ccc(F)cc3C5(C)C)cc2)C1.
What is the InChIKey of CID 58250758?
The InChIKey is XKAWJDRXGNYTRE-UHFFFAOYSA-N. The full InChI is InChI=1S/C41H37F2NO2Si/c1-40(2)36-23-30(43)14-18-33(36)37-32-17-13-29(42)22-35(32)39-34(38(37)40)19-20-41(46-39,27-9-5-4-6-10-27)28-11-15-31(16-12-28)44-21-7-8-26(24-44)25-45-47-3/h4-6,9-20,22-23,26H,7-8,21,24-25H2,1-3H3.
What are the key properties of CID 58250758?
CID 58250758 has a molecular weight of 641.83 g/mol, XLogP of 9.67, 6 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for CID 58250758 is sourced from PubChem (CID 58250758), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).