C55H42IrN2O3-2 — CID 58250833
iridium;[4-[2-[4-[2-methyl-9-(4-methylphenyl)fluoren-9-yl]phenoxy]ethoxy]phenyl]-pyrrol-1-id-2-ylmethanone;1-phenylisoquinoline (PubChem CID 58250833) has the molecular formula C55H42IrN2O3-2 and a molecular weight of 971.17 g/mol. Its IUPAC name is iridium;[4-[2-[4-[2-methyl-9-(4-methylphenyl)fluoren-9-yl]phenoxy]ethoxy]phenyl]-pyrrol-1-id-2-ylmethanone;1-phenylisoquinoline.
| Compound Name | iridium;[4-[2-[4-[2-methyl-9-(4-methylphenyl)fluoren-9-yl]phenoxy]ethoxy]phenyl]-pyrrol-1-id-2-ylmethanone;1-phenylisoquinoline |
|---|---|
| PubChem CID | 58250833 |
| Molecular Formula | C55H42IrN2O3-2 |
| Molecular Weight | 971.17 g/mol |
| Exact Mass | 971.28 |
| IUPAC Name | iridium;[4-[2-[4-[2-methyl-9-(4-methylphenyl)fluoren-9-yl]phenoxy]ethoxy]phenyl]-pyrrol-1-id-2-ylmethanone;1-phenylisoquinoline |
| SMILES | Cc1ccc(C2(c3ccc(OCCOc4ccc(C(=O)c5ccc[n-]5)cc4)cc3)c3ccccc3-c3ccc(C)cc32)cc1.[Ir].[c-]1ccccc1-c1nccc2ccccc12 |
| InChI | InChI=1S/C40H33NO3.C15H10N.Ir/c1-27-9-14-30(15-10-27)40(36-7-4-3-6-34(36)35-22-11-28(2)26-37(35)40)31-16-20-33(21-17-31)44-25-24-43-32-18-12-29(13-19-32)39(42)38-8-5-23-41-38;1-2-7-13(8-3-1)15-14-9-5-4-6-12(14)10-11-16-15;/h3-23,26H,24-25H2,1-2H3,(H,41,42);1-7,9-11H;/q;-1;/p-1 |
| InChIKey | FNGHXIORFLGVOV-UHFFFAOYSA-M |
| XLogP | 12.01 |
| TPSA | 62.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 61 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 971.17 |
| LogP ≤ 5 | 12.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|