C82H100N2 — CID 58251074
N-[4-[9,9-dihexyl-7-[4-(N-methyl-4-propan-2-ylanilino)phenyl]fluoren-2-yl]phenyl]-9,9-dihexyl-7-methyl-N-(4-propan-2-ylphenyl)fluoren-2-amine (PubChem CID 58251074) has the molecular formula C82H100N2 and a molecular weight of 1113.72 g/mol. Its IUPAC name is N-[4-[9,9-dihexyl-7-[4-(N-methyl-4-propan-2-ylanilino)phenyl]fluoren-2-yl]phenyl]-9,9-dihexyl-7-methyl-N-(4-propan-2-ylphenyl)fluoren-2-amine.
| Compound Name | N-[4-[9,9-dihexyl-7-[4-(N-methyl-4-propan-2-ylanilino)phenyl]fluoren-2-yl]phenyl]-9,9-dihexyl-7-methyl-N-(4-propan-2-ylphenyl)fluoren-2-amine |
|---|---|
| PubChem CID | 58251074 |
| Molecular Formula | C82H100N2 |
| Molecular Weight | 1113.72 g/mol |
| Exact Mass | 1112.79 |
| IUPAC Name | N-[4-[9,9-dihexyl-7-[4-(N-methyl-4-propan-2-ylanilino)phenyl]fluoren-2-yl]phenyl]-9,9-dihexyl-7-methyl-N-(4-propan-2-ylphenyl)fluoren-2-amine |
| SMILES | CCCCCCC1(CCCCCC)c2cc(-c3ccc(N(C)c4ccc(C(C)C)cc4)cc3)ccc2-c2ccc(-c3ccc(N(c4ccc(C(C)C)cc4)c4ccc5c(c4)C(CCCCCC)(CCCCCC)c4cc(C)ccc4-5)cc3)cc21 |
| InChI | InChI=1S/C82H100N2/c1-11-15-19-23-51-81(52-24-20-16-12-2)77-55-61(9)27-47-73(77)76-50-46-72(58-80(76)81)84(70-42-30-63(31-43-70)60(7)8)71-44-34-65(35-45-71)67-37-49-75-74-48-36-66(64-32-40-69(41-33-64)83(10)68-38-28-62(29-39-68)59(5)6)56-78(74)82(79(75)57-67,53-25-21-17-13-3)54-26-22-18-14-4/h27-50,55-60H,11-26,51-54H2,1-10H3 |
| InChIKey | PDAKQWKEAIPRRG-UHFFFAOYSA-N |
| XLogP | 25.23 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 29 |
| Heavy Atoms | 84 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1113.72 |
| LogP ≤ 5 | 25.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|