About 10-[3,5-di(pyrimidin-4-yl)phenyl]phenoxazine
10-[3,5-di(pyrimidin-4-yl)phenyl]phenoxazine (PubChem CID 58251182) has the molecular formula C26H17N5O
and a molecular weight of 415.46 g/mol. Its IUPAC name is 10-[3,5-di(pyrimidin-4-yl)phenyl]phenoxazine.
Molecular Properties
| Compound Name | 10-[3,5-di(pyrimidin-4-yl)phenyl]phenoxazine |
| PubChem CID | 58251182 |
| Molecular Formula | C26H17N5O |
| Molecular Weight | 415.46 g/mol |
| Exact Mass | 415.14 |
| IUPAC Name | 10-[3,5-di(pyrimidin-4-yl)phenyl]phenoxazine |
| SMILES | c1ccc2c(c1)Oc1ccccc1N2c1cc(-c2ccncn2)cc(-c2ccncn2)c1 |
| InChI | InChI=1S/C26H17N5O/c1-3-7-25-23(5-1)31(24-6-2-4-8-26(24)32-25)20-14-18(21-9-11-27-16-29-21)13-19(15-20)22-10-12-28-17-30-22/h1-17H |
| InChIKey | REJYIZVSUNDKDO-UHFFFAOYSA-N |
| XLogP | 6.18 |
| TPSA | 64.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 415.46 |
| LogP ≤ 5 | 6.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 10-[3,5-di(pyrimidin-4-yl)phenyl]phenoxazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 10-[3,5-di(pyrimidin-4-yl)phenyl]phenoxazine?
The IUPAC name of 10-[3,5-di(pyrimidin-4-yl)phenyl]phenoxazine (CID 58251182) is 10-[3,5-di(pyrimidin-4-yl)phenyl]phenoxazine.
What is the SMILES notation for 10-[3,5-di(pyrimidin-4-yl)phenyl]phenoxazine?
The canonical SMILES for 10-[3,5-di(pyrimidin-4-yl)phenyl]phenoxazine is c1ccc2c(c1)Oc1ccccc1N2c1cc(-c2ccncn2)cc(-c2ccncn2)c1.
What is the InChIKey of 10-[3,5-di(pyrimidin-4-yl)phenyl]phenoxazine?
The InChIKey is REJYIZVSUNDKDO-UHFFFAOYSA-N. The full InChI is InChI=1S/C26H17N5O/c1-3-7-25-23(5-1)31(24-6-2-4-8-26(24)32-25)20-14-18(21-9-11-27-16-29-21)13-19(15-20)22-10-12-28-17-30-22/h1-17H.
What are the key properties of 10-[3,5-di(pyrimidin-4-yl)phenyl]phenoxazine?
10-[3,5-di(pyrimidin-4-yl)phenyl]phenoxazine has a molecular weight of 415.46 g/mol, XLogP of 6.18, 3 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 10-[3,5-di(pyrimidin-4-yl)phenyl]phenoxazine is sourced from PubChem (CID 58251182), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).