C36H26AlFN2O3 — CID 58251661
(4-fluoro-5-phenylnaphthalen-1-yl)oxy-bis[(2-methylquinolin-8-yl)oxy]alumane (PubChem CID 58251661) has the molecular formula C36H26AlFN2O3 and a molecular weight of 580.60 g/mol. Its IUPAC name is (4-fluoro-5-phenylnaphthalen-1-yl)oxy-bis[(2-methylquinolin-8-yl)oxy]alumane.
| Compound Name | (4-fluoro-5-phenylnaphthalen-1-yl)oxy-bis[(2-methylquinolin-8-yl)oxy]alumane |
|---|---|
| PubChem CID | 58251661 |
| Molecular Formula | C36H26AlFN2O3 |
| Molecular Weight | 580.60 g/mol |
| Exact Mass | 580.17 |
| IUPAC Name | (4-fluoro-5-phenylnaphthalen-1-yl)oxy-bis[(2-methylquinolin-8-yl)oxy]alumane |
| SMILES | Cc1ccc2cccc(O[Al](Oc3ccc(F)c4c(-c5ccccc5)cccc34)Oc3cccc4ccc(C)nc34)c2n1 |
| InChI | InChI=1S/C16H11FO.2C10H9NO.Al/c17-14-9-10-15(18)13-8-4-7-12(16(13)14)11-5-2-1-3-6-11;2*1-7-5-6-8-3-2-4-9(12)10(8)11-7;/h1-10,18H;2*2-6,12H,1H3;/q;;;+3/p-3 |
| InChIKey | BOSUNQMTJWSOQX-UHFFFAOYSA-K |
| XLogP | 8.88 |
| TPSA | 53.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 580.60 |
| LogP ≤ 5 | 8.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |