About 9,10-bis(2-bromophenyl)-2-chloroanthracene-9,10-diol
9,10-bis(2-bromophenyl)-2-chloroanthracene-9,10-diol (PubChem CID 58251733) has the molecular formula C26H17Br2ClO2
and a molecular weight of 556.68 g/mol. Its IUPAC name is 9,10-bis(2-bromophenyl)-2-chloroanthracene-9,10-diol.
Molecular Properties
| Compound Name | 9,10-bis(2-bromophenyl)-2-chloroanthracene-9,10-diol |
| PubChem CID | 58251733 |
| Molecular Formula | C26H17Br2ClO2 |
| Molecular Weight | 556.68 g/mol |
| Exact Mass | 553.93 |
| IUPAC Name | 9,10-bis(2-bromophenyl)-2-chloroanthracene-9,10-diol |
| SMILES | OC1(c2ccccc2Br)c2ccccc2C(O)(c2ccccc2Br)c2cc(Cl)ccc21 |
| InChI | InChI=1S/C26H17Br2ClO2/c27-23-11-5-3-9-20(23)25(30)17-7-1-2-8-18(17)26(31,21-10-4-6-12-24(21)28)22-15-16(29)13-14-19(22)25/h1-15,30-31H |
| InChIKey | FKKYBZOZCJWHPM-UHFFFAOYSA-N |
| XLogP | 6.75 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 556.68 |
| LogP ≤ 5 | 6.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 9,10-bis(2-bromophenyl)-2-chloroanthracene-9,10-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 9,10-bis(2-bromophenyl)-2-chloroanthracene-9,10-diol?
The IUPAC name of 9,10-bis(2-bromophenyl)-2-chloroanthracene-9,10-diol (CID 58251733) is 9,10-bis(2-bromophenyl)-2-chloroanthracene-9,10-diol.
What is the SMILES notation for 9,10-bis(2-bromophenyl)-2-chloroanthracene-9,10-diol?
The canonical SMILES for 9,10-bis(2-bromophenyl)-2-chloroanthracene-9,10-diol is OC1(c2ccccc2Br)c2ccccc2C(O)(c2ccccc2Br)c2cc(Cl)ccc21.
What is the InChIKey of 9,10-bis(2-bromophenyl)-2-chloroanthracene-9,10-diol?
The InChIKey is FKKYBZOZCJWHPM-UHFFFAOYSA-N. The full InChI is InChI=1S/C26H17Br2ClO2/c27-23-11-5-3-9-20(23)25(30)17-7-1-2-8-18(17)26(31,21-10-4-6-12-24(21)28)22-15-16(29)13-14-19(22)25/h1-15,30-31H.
What are the key properties of 9,10-bis(2-bromophenyl)-2-chloroanthracene-9,10-diol?
9,10-bis(2-bromophenyl)-2-chloroanthracene-9,10-diol has a molecular weight of 556.68 g/mol, XLogP of 6.75, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 9,10-bis(2-bromophenyl)-2-chloroanthracene-9,10-diol is sourced from PubChem (CID 58251733), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).