About [6,7-bis(aminomethyl)-4-nitro-1-azabicyclo[2.2.2]octan-2-yl]methanamine
[6,7-bis(aminomethyl)-4-nitro-1-azabicyclo[2.2.2]octan-2-yl]methanamine (PubChem CID 58251882) has the molecular formula C10H21N5O2
and a molecular weight of 243.31 g/mol. Its IUPAC name is [6,7-bis(aminomethyl)-4-nitro-1-azabicyclo[2.2.2]octan-2-yl]methanamine.
Molecular Properties
| Compound Name | [6,7-bis(aminomethyl)-4-nitro-1-azabicyclo[2.2.2]octan-2-yl]methanamine |
| PubChem CID | 58251882 |
| Molecular Formula | C10H21N5O2 |
| Molecular Weight | 243.31 g/mol |
| Exact Mass | 243.17 |
| IUPAC Name | [6,7-bis(aminomethyl)-4-nitro-1-azabicyclo[2.2.2]octan-2-yl]methanamine |
| SMILES | NCC1CC2([N+](=O)[O-])CC(CN)N1C(CN)C2 |
| InChI | InChI=1S/C10H21N5O2/c11-4-7-1-10(15(16)17)2-8(5-12)14(7)9(3-10)6-13/h7-9H,1-6,11-13H2 |
| InChIKey | WXBFFIKCCMZKAB-UHFFFAOYSA-N |
| XLogP | -1.52 |
| TPSA | 124.44 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 243.31 |
| LogP ≤ 5 | -1.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze [6,7-bis(aminomethyl)-4-nitro-1-azabicyclo[2.2.2]octan-2-yl]methanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [6,7-bis(aminomethyl)-4-nitro-1-azabicyclo[2.2.2]octan-2-yl]methanamine?
The IUPAC name of [6,7-bis(aminomethyl)-4-nitro-1-azabicyclo[2.2.2]octan-2-yl]methanamine (CID 58251882) is [6,7-bis(aminomethyl)-4-nitro-1-azabicyclo[2.2.2]octan-2-yl]methanamine.
What is the SMILES notation for [6,7-bis(aminomethyl)-4-nitro-1-azabicyclo[2.2.2]octan-2-yl]methanamine?
The canonical SMILES for [6,7-bis(aminomethyl)-4-nitro-1-azabicyclo[2.2.2]octan-2-yl]methanamine is NCC1CC2([N+](=O)[O-])CC(CN)N1C(CN)C2.
What is the InChIKey of [6,7-bis(aminomethyl)-4-nitro-1-azabicyclo[2.2.2]octan-2-yl]methanamine?
The InChIKey is WXBFFIKCCMZKAB-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H21N5O2/c11-4-7-1-10(15(16)17)2-8(5-12)14(7)9(3-10)6-13/h7-9H,1-6,11-13H2.
What are the key properties of [6,7-bis(aminomethyl)-4-nitro-1-azabicyclo[2.2.2]octan-2-yl]methanamine?
[6,7-bis(aminomethyl)-4-nitro-1-azabicyclo[2.2.2]octan-2-yl]methanamine has a molecular weight of 243.31 g/mol, XLogP of -1.52, 4 rotatable bonds, 3 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for [6,7-bis(aminomethyl)-4-nitro-1-azabicyclo[2.2.2]octan-2-yl]methanamine is sourced from PubChem (CID 58251882), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).