C13H16ClN3OS — CID 58252145
(4aR,7aR)-7a-(5-chlorothiophen-2-yl)-3,6-dimethyl-2-methylidene-1,4a,5,7-tetrahydropyrrolo[3,4-d]pyrimidin-4-one (PubChem CID 58252145) has the molecular formula C13H16ClN3OS and a molecular weight of 297.81 g/mol. Its IUPAC name is (4aR,7aR)-7a-(5-chlorothiophen-2-yl)-3,6-dimethyl-2-methylidene-1,4a,5,7-tetrahydropyrrolo[3,4-d]pyrimidin-4-one.
| Compound Name | (4aR,7aR)-7a-(5-chlorothiophen-2-yl)-3,6-dimethyl-2-methylidene-1,4a,5,7-tetrahydropyrrolo[3,4-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 58252145 |
| Molecular Formula | C13H16ClN3OS |
| Molecular Weight | 297.81 g/mol |
| Exact Mass | 297.07 |
| IUPAC Name | (4aR,7aR)-7a-(5-chlorothiophen-2-yl)-3,6-dimethyl-2-methylidene-1,4a,5,7-tetrahydropyrrolo[3,4-d]pyrimidin-4-one |
| SMILES | C=C1N[C@@]2(c3ccc(Cl)s3)CN(C)C[C@H]2C(=O)N1C |
| InChI | InChI=1S/C13H16ClN3OS/c1-8-15-13(10-4-5-11(14)19-10)7-16(2)6-9(13)12(18)17(8)3/h4-5,9,15H,1,6-7H2,2-3H3/t9-,13-/m0/s1 |
| InChIKey | ILJRROKPNFRXLS-ZANVPECISA-N |
| XLogP | 1.69 |
| TPSA | 35.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.81 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |