C17H21N5O3S — CID 58252153
tert-butyl N-[(4aR,7aR)-7a-(5-isocyanothiophen-2-yl)-3-methyl-4-oxo-4a,5,6,7-tetrahydropyrrolo[3,4-d]pyrimidin-2-yl]carbamate (PubChem CID 58252153) has the molecular formula C17H21N5O3S and a molecular weight of 375.45 g/mol. Its IUPAC name is tert-butyl N-[(4aR,7aR)-7a-(5-isocyanothiophen-2-yl)-3-methyl-4-oxo-4a,5,6,7-tetrahydropyrrolo[3,4-d]pyrimidin-2-yl]carbamate.
| Compound Name | tert-butyl N-[(4aR,7aR)-7a-(5-isocyanothiophen-2-yl)-3-methyl-4-oxo-4a,5,6,7-tetrahydropyrrolo[3,4-d]pyrimidin-2-yl]carbamate |
|---|---|
| PubChem CID | 58252153 |
| Molecular Formula | C17H21N5O3S |
| Molecular Weight | 375.45 g/mol |
| Exact Mass | 375.14 |
| IUPAC Name | tert-butyl N-[(4aR,7aR)-7a-(5-isocyanothiophen-2-yl)-3-methyl-4-oxo-4a,5,6,7-tetrahydropyrrolo[3,4-d]pyrimidin-2-yl]carbamate |
| SMILES | [C-]#[N+]c1ccc([C@]23CNC[C@H]2C(=O)N(C)C(NC(=O)OC(C)(C)C)=N3)s1 |
| InChI | InChI=1S/C17H21N5O3S/c1-16(2,3)25-15(24)20-14-21-17(11-6-7-12(18-4)26-11)9-19-8-10(17)13(23)22(14)5/h6-7,10,19H,8-9H2,1-3,5H3,(H,20,21,24)/t10-,17-/m0/s1 |
| InChIKey | RFZFDDXCNUOAMD-BTDLBPIBSA-N |
| XLogP | 2.07 |
| TPSA | 87.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.45 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|