C28H45NO5 — CID 58252190
(1R,2R,5S,6R)-6-hydroxy-1-methoxy-1-[(2S)-1-[(3R,4S)-3-methoxy-4,5-dimethylhexanoyl]pyrrolidin-2-yl]-2,5-dimethyl-6-phenylhexan-3-one (PubChem CID 58252190) has the molecular formula C28H45NO5 and a molecular weight of 475.67 g/mol. Its IUPAC name is (1R,2R,5S,6R)-6-hydroxy-1-methoxy-1-[(2S)-1-[(3R,4S)-3-methoxy-4,5-dimethylhexanoyl]pyrrolidin-2-yl]-2,5-dimethyl-6-phenylhexan-3-one.
| Compound Name | (1R,2R,5S,6R)-6-hydroxy-1-methoxy-1-[(2S)-1-[(3R,4S)-3-methoxy-4,5-dimethylhexanoyl]pyrrolidin-2-yl]-2,5-dimethyl-6-phenylhexan-3-one |
|---|---|
| PubChem CID | 58252190 |
| Molecular Formula | C28H45NO5 |
| Molecular Weight | 475.67 g/mol |
| Exact Mass | 475.33 |
| IUPAC Name | (1R,2R,5S,6R)-6-hydroxy-1-methoxy-1-[(2S)-1-[(3R,4S)-3-methoxy-4,5-dimethylhexanoyl]pyrrolidin-2-yl]-2,5-dimethyl-6-phenylhexan-3-one |
| SMILES | CO[C@H]([C@@H](C)C(=O)C[C@H](C)[C@@H](O)c1ccccc1)[C@@H]1CCCN1C(=O)C[C@@H](OC)[C@@H](C)C(C)C |
| InChI | InChI=1S/C28H45NO5/c1-18(2)20(4)25(33-6)17-26(31)29-15-11-14-23(29)28(34-7)21(5)24(30)16-19(3)27(32)22-12-9-8-10-13-22/h8-10,12-13,18-21,23,25,27-28,32H,11,14-17H2,1-7H3/t19-,20-,21-,23-,25+,27+,28+/m0/s1 |
| InChIKey | PZNLEZFOBSQUSQ-RQIUTTPNSA-N |
| XLogP | 4.65 |
| TPSA | 76.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.67 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |