C22H21ClF2O4S — CID 58252205
(2R,3aS,3bR,9bS,11aR)-9b-(4-chlorophenyl)sulfonyl-6,9-difluoro-2-methyl-2,3,3a,3b,4,10,11,11a-octahydro-[1]benzofuro[4,5-c]chromene (PubChem CID 58252205) has the molecular formula C22H21ClF2O4S and a molecular weight of 454.92 g/mol. Its IUPAC name is (2R,3aS,3bR,9bS,11aR)-9b-(4-chlorophenyl)sulfonyl-6,9-difluoro-2-methyl-2,3,3a,3b,4,10,11,11a-octahydro-[1]benzofuro[4,5-c]chromene.
| Compound Name | (2R,3aS,3bR,9bS,11aR)-9b-(4-chlorophenyl)sulfonyl-6,9-difluoro-2-methyl-2,3,3a,3b,4,10,11,11a-octahydro-[1]benzofuro[4,5-c]chromene |
|---|---|
| PubChem CID | 58252205 |
| Molecular Formula | C22H21ClF2O4S |
| Molecular Weight | 454.92 g/mol |
| Exact Mass | 454.08 |
| IUPAC Name | (2R,3aS,3bR,9bS,11aR)-9b-(4-chlorophenyl)sulfonyl-6,9-difluoro-2-methyl-2,3,3a,3b,4,10,11,11a-octahydro-[1]benzofuro[4,5-c]chromene |
| SMILES | C[C@@H]1C[C@@H]2[C@@H](CC[C@@]3(S(=O)(=O)c4ccc(Cl)cc4)c4c(F)ccc(F)c4OC[C@@H]23)O1 |
| InChI | InChI=1S/C22H21ClF2O4S/c1-12-10-15-16-11-28-21-18(25)7-6-17(24)20(21)22(16,9-8-19(15)29-12)30(26,27)14-4-2-13(23)3-5-14/h2-7,12,15-16,19H,8-11H2,1H3/t12-,15+,16+,19-,22+/m1/s1 |
| InChIKey | ODDQWNMWODYMAD-XOCNHOQBSA-N |
| XLogP | 4.88 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.92 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |