C24H26ClF2NO3S — CID 58252207
(1S,2S,4R,7R,10S)-10-[(4-chlorophenyl)methyl]-4-ethyl-12,15-difluoro-17-oxa-5λ6-thia-6-azatetracyclo[8.8.0.02,7.011,16]octadeca-11,13,15-triene 5,5-dioxide (PubChem CID 58252207) has the molecular formula C24H26ClF2NO3S and a molecular weight of 481.99 g/mol. Its IUPAC name is (1S,2S,4R,7R,10S)-10-[(4-chlorophenyl)methyl]-4-ethyl-12,15-difluoro-17-oxa-5λ6-thia-6-azatetracyclo[8.8.0.02,7.011,16]octadeca-11,13,15-triene 5,5-dioxide.
| Compound Name | (1S,2S,4R,7R,10S)-10-[(4-chlorophenyl)methyl]-4-ethyl-12,15-difluoro-17-oxa-5λ6-thia-6-azatetracyclo[8.8.0.02,7.011,16]octadeca-11,13,15-triene 5,5-dioxide |
|---|---|
| PubChem CID | 58252207 |
| Molecular Formula | C24H26ClF2NO3S |
| Molecular Weight | 481.99 g/mol |
| Exact Mass | 481.13 |
| IUPAC Name | (1S,2S,4R,7R,10S)-10-[(4-chlorophenyl)methyl]-4-ethyl-12,15-difluoro-17-oxa-5λ6-thia-6-azatetracyclo[8.8.0.02,7.011,16]octadeca-11,13,15-triene 5,5-dioxide |
| SMILES | CC[C@@H]1C[C@@H]2[C@@H](CC[C@@]3(Cc4ccc(Cl)cc4)c4c(F)ccc(F)c4OC[C@@H]23)NS1(=O)=O |
| InChI | InChI=1S/C24H26ClF2NO3S/c1-2-16-11-17-18-13-31-23-20(27)8-7-19(26)22(23)24(18,10-9-21(17)28-32(16,29)30)12-14-3-5-15(25)6-4-14/h3-8,16-18,21,28H,2,9-13H2,1H3/t16-,17+,18+,21-,24+/m1/s1 |
| InChIKey | YALMZAIAURYATC-JZHQAKKZSA-N |
| XLogP | 4.99 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.99 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |