C23H24ClF2NO5S2 — CID 58252220
(1R,2S,7R,10S)-10-(4-chlorophenyl)sulfonyl-6-ethyl-12,15-difluoro-17-oxa-5λ6-thia-6-azatetracyclo[8.8.0.02,7.011,16]octadeca-11,13,15-triene 5,5-dioxide (PubChem CID 58252220) has the molecular formula C23H24ClF2NO5S2 and a molecular weight of 532.03 g/mol. Its IUPAC name is (1R,2S,7R,10S)-10-(4-chlorophenyl)sulfonyl-6-ethyl-12,15-difluoro-17-oxa-5λ6-thia-6-azatetracyclo[8.8.0.02,7.011,16]octadeca-11,13,15-triene 5,5-dioxide.
| Compound Name | (1R,2S,7R,10S)-10-(4-chlorophenyl)sulfonyl-6-ethyl-12,15-difluoro-17-oxa-5λ6-thia-6-azatetracyclo[8.8.0.02,7.011,16]octadeca-11,13,15-triene 5,5-dioxide |
|---|---|
| PubChem CID | 58252220 |
| Molecular Formula | C23H24ClF2NO5S2 |
| Molecular Weight | 532.03 g/mol |
| Exact Mass | 531.08 |
| IUPAC Name | (1R,2S,7R,10S)-10-(4-chlorophenyl)sulfonyl-6-ethyl-12,15-difluoro-17-oxa-5λ6-thia-6-azatetracyclo[8.8.0.02,7.011,16]octadeca-11,13,15-triene 5,5-dioxide |
| SMILES | CCN1[C@@H]2CC[C@@]3(S(=O)(=O)c4ccc(Cl)cc4)c4c(F)ccc(F)c4OC[C@H]3[C@@H]2CCS1(=O)=O |
| InChI | InChI=1S/C23H24ClF2NO5S2/c1-2-27-20-9-11-23(34(30,31)15-5-3-14(24)4-6-15)17(16(20)10-12-33(27,28)29)13-32-22-19(26)8-7-18(25)21(22)23/h3-8,16-17,20H,2,9-13H2,1H3/t16-,17-,20+,23-/m0/s1 |
| InChIKey | YHPOWLKDFZFIBF-GPZXFYDGSA-N |
| XLogP | 4.13 |
| TPSA | 80.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.03 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |