About 5-fluoro-4,6-dimethoxy-2-propan-2-ylpyrimidine
5-fluoro-4,6-dimethoxy-2-propan-2-ylpyrimidine (PubChem CID 58252308) has the molecular formula C9H13FN2O2
and a molecular weight of 200.21 g/mol. Its IUPAC name is 5-fluoro-4,6-dimethoxy-2-propan-2-ylpyrimidine.
Molecular Properties
| Compound Name | 5-fluoro-4,6-dimethoxy-2-propan-2-ylpyrimidine |
| PubChem CID | 58252308 |
| Molecular Formula | C9H13FN2O2 |
| Molecular Weight | 200.21 g/mol |
| Exact Mass | 200.10 |
| IUPAC Name | 5-fluoro-4,6-dimethoxy-2-propan-2-ylpyrimidine |
| SMILES | COc1nc(C(C)C)nc(OC)c1F |
| InChI | InChI=1S/C9H13FN2O2/c1-5(2)7-11-8(13-3)6(10)9(12-7)14-4/h5H,1-4H3 |
| InChIKey | LIHWQYBSIDEIQG-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 44.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 200.21 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 5-fluoro-4,6-dimethoxy-2-propan-2-ylpyrimidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-fluoro-4,6-dimethoxy-2-propan-2-ylpyrimidine?
The IUPAC name of 5-fluoro-4,6-dimethoxy-2-propan-2-ylpyrimidine (CID 58252308) is 5-fluoro-4,6-dimethoxy-2-propan-2-ylpyrimidine.
What is the SMILES notation for 5-fluoro-4,6-dimethoxy-2-propan-2-ylpyrimidine?
The canonical SMILES for 5-fluoro-4,6-dimethoxy-2-propan-2-ylpyrimidine is COc1nc(C(C)C)nc(OC)c1F.
What is the InChIKey of 5-fluoro-4,6-dimethoxy-2-propan-2-ylpyrimidine?
The InChIKey is LIHWQYBSIDEIQG-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H13FN2O2/c1-5(2)7-11-8(13-3)6(10)9(12-7)14-4/h5H,1-4H3.
What are the key properties of 5-fluoro-4,6-dimethoxy-2-propan-2-ylpyrimidine?
5-fluoro-4,6-dimethoxy-2-propan-2-ylpyrimidine has a molecular weight of 200.21 g/mol, XLogP of 1.76, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-fluoro-4,6-dimethoxy-2-propan-2-ylpyrimidine is sourced from PubChem (CID 58252308), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).