About methyl 1-benzyl-4-(2,4-difluorophenyl)-4-formyloxypyrrolidine-3-carboxylate
methyl 1-benzyl-4-(2,4-difluorophenyl)-4-formyloxypyrrolidine-3-carboxylate (PubChem CID 58252358) has the molecular formula C20H19F2NO4
and a molecular weight of 375.37 g/mol. Its IUPAC name is methyl 1-benzyl-4-(2,4-difluorophenyl)-4-formyloxypyrrolidine-3-carboxylate.
Molecular Properties
| Compound Name | methyl 1-benzyl-4-(2,4-difluorophenyl)-4-formyloxypyrrolidine-3-carboxylate |
| PubChem CID | 58252358 |
| Molecular Formula | C20H19F2NO4 |
| Molecular Weight | 375.37 g/mol |
| Exact Mass | 375.13 |
| IUPAC Name | methyl 1-benzyl-4-(2,4-difluorophenyl)-4-formyloxypyrrolidine-3-carboxylate |
| SMILES | COC(=O)C1CN(Cc2ccccc2)CC1(OC=O)c1ccc(F)cc1F |
| InChI | InChI=1S/C20H19F2NO4/c1-26-19(25)17-11-23(10-14-5-3-2-4-6-14)12-20(17,27-13-24)16-8-7-15(21)9-18(16)22/h2-9,13,17H,10-12H2,1H3 |
| InChIKey | ZMUNOXODHKVTHB-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 375.37 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze methyl 1-benzyl-4-(2,4-difluorophenyl)-4-formyloxypyrrolidine-3-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 1-benzyl-4-(2,4-difluorophenyl)-4-formyloxypyrrolidine-3-carboxylate?
The IUPAC name of methyl 1-benzyl-4-(2,4-difluorophenyl)-4-formyloxypyrrolidine-3-carboxylate (CID 58252358) is methyl 1-benzyl-4-(2,4-difluorophenyl)-4-formyloxypyrrolidine-3-carboxylate.
What is the SMILES notation for methyl 1-benzyl-4-(2,4-difluorophenyl)-4-formyloxypyrrolidine-3-carboxylate?
The canonical SMILES for methyl 1-benzyl-4-(2,4-difluorophenyl)-4-formyloxypyrrolidine-3-carboxylate is COC(=O)C1CN(Cc2ccccc2)CC1(OC=O)c1ccc(F)cc1F.
What is the InChIKey of methyl 1-benzyl-4-(2,4-difluorophenyl)-4-formyloxypyrrolidine-3-carboxylate?
The InChIKey is ZMUNOXODHKVTHB-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H19F2NO4/c1-26-19(25)17-11-23(10-14-5-3-2-4-6-14)12-20(17,27-13-24)16-8-7-15(21)9-18(16)22/h2-9,13,17H,10-12H2,1H3.
What are the key properties of methyl 1-benzyl-4-(2,4-difluorophenyl)-4-formyloxypyrrolidine-3-carboxylate?
methyl 1-benzyl-4-(2,4-difluorophenyl)-4-formyloxypyrrolidine-3-carboxylate has a molecular weight of 375.37 g/mol, XLogP of 2.64, 6 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 1-benzyl-4-(2,4-difluorophenyl)-4-formyloxypyrrolidine-3-carboxylate is sourced from PubChem (CID 58252358), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).