About 2-chloro-5-fluoro-4,6-dimethoxypyrimidine
2-chloro-5-fluoro-4,6-dimethoxypyrimidine (PubChem CID 58252374) has the molecular formula C6H6ClFN2O2
and a molecular weight of 192.58 g/mol. Its IUPAC name is 2-chloro-5-fluoro-4,6-dimethoxypyrimidine.
Molecular Properties
| Compound Name | 2-chloro-5-fluoro-4,6-dimethoxypyrimidine |
| PubChem CID | 58252374 |
| Molecular Formula | C6H6ClFN2O2 |
| Molecular Weight | 192.58 g/mol |
| Exact Mass | 192.01 |
| IUPAC Name | 2-chloro-5-fluoro-4,6-dimethoxypyrimidine |
| SMILES | COc1nc(Cl)nc(OC)c1F |
| InChI | InChI=1S/C6H6ClFN2O2/c1-11-4-3(8)5(12-2)10-6(7)9-4/h1-2H3 |
| InChIKey | LSPBNYKEPNIXFR-UHFFFAOYSA-N |
| XLogP | 1.29 |
| TPSA | 44.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 192.58 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-chloro-5-fluoro-4,6-dimethoxypyrimidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-chloro-5-fluoro-4,6-dimethoxypyrimidine?
The IUPAC name of 2-chloro-5-fluoro-4,6-dimethoxypyrimidine (CID 58252374) is 2-chloro-5-fluoro-4,6-dimethoxypyrimidine.
What is the SMILES notation for 2-chloro-5-fluoro-4,6-dimethoxypyrimidine?
The canonical SMILES for 2-chloro-5-fluoro-4,6-dimethoxypyrimidine is COc1nc(Cl)nc(OC)c1F.
What is the InChIKey of 2-chloro-5-fluoro-4,6-dimethoxypyrimidine?
The InChIKey is LSPBNYKEPNIXFR-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H6ClFN2O2/c1-11-4-3(8)5(12-2)10-6(7)9-4/h1-2H3.
What are the key properties of 2-chloro-5-fluoro-4,6-dimethoxypyrimidine?
2-chloro-5-fluoro-4,6-dimethoxypyrimidine has a molecular weight of 192.58 g/mol, XLogP of 1.29, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-chloro-5-fluoro-4,6-dimethoxypyrimidine is sourced from PubChem (CID 58252374), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).