About 2-fluoro-1,3,5-trimethylcyclohexane
2-fluoro-1,3,5-trimethylcyclohexane (PubChem CID 58252639) has the molecular formula C9H17F
and a molecular weight of 144.23 g/mol. Its IUPAC name is 2-fluoro-1,3,5-trimethylcyclohexane.
Molecular Properties
| Compound Name | 2-fluoro-1,3,5-trimethylcyclohexane |
| PubChem CID | 58252639 |
| Molecular Formula | C9H17F |
| Molecular Weight | 144.23 g/mol |
| Exact Mass | 144.13 |
| IUPAC Name | 2-fluoro-1,3,5-trimethylcyclohexane |
| SMILES | CC1CC(C)C(F)C(C)C1 |
| InChI | InChI=1S/C9H17F/c1-6-4-7(2)9(10)8(3)5-6/h6-9H,4-5H2,1-3H3 |
| InChIKey | MIBJLWICIZHKER-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 144.23 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze 2-fluoro-1,3,5-trimethylcyclohexane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-fluoro-1,3,5-trimethylcyclohexane?
The IUPAC name of 2-fluoro-1,3,5-trimethylcyclohexane (CID 58252639) is 2-fluoro-1,3,5-trimethylcyclohexane.
What is the SMILES notation for 2-fluoro-1,3,5-trimethylcyclohexane?
The canonical SMILES for 2-fluoro-1,3,5-trimethylcyclohexane is CC1CC(C)C(F)C(C)C1.
What is the InChIKey of 2-fluoro-1,3,5-trimethylcyclohexane?
The InChIKey is MIBJLWICIZHKER-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H17F/c1-6-4-7(2)9(10)8(3)5-6/h6-9H,4-5H2,1-3H3.
What are the key properties of 2-fluoro-1,3,5-trimethylcyclohexane?
2-fluoro-1,3,5-trimethylcyclohexane has a molecular weight of 144.23 g/mol, XLogP of 3.03, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 2-fluoro-1,3,5-trimethylcyclohexane is sourced from PubChem (CID 58252639), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).