C21H30F2O4 — CID 58252759
2,2-difluoropropyl 10-(2-methylbutanoyloxy)tetracyclo[6.2.1.13,6.02,7]dodecane-4-carboxylate (PubChem CID 58252759) has the molecular formula C21H30F2O4 and a molecular weight of 384.46 g/mol. Its IUPAC name is 2,2-difluoropropyl 10-(2-methylbutanoyloxy)tetracyclo[6.2.1.13,6.02,7]dodecane-4-carboxylate.
| Compound Name | 2,2-difluoropropyl 10-(2-methylbutanoyloxy)tetracyclo[6.2.1.13,6.02,7]dodecane-4-carboxylate |
|---|---|
| PubChem CID | 58252759 |
| Molecular Formula | C21H30F2O4 |
| Molecular Weight | 384.46 g/mol |
| Exact Mass | 384.21 |
| IUPAC Name | 2,2-difluoropropyl 10-(2-methylbutanoyloxy)tetracyclo[6.2.1.13,6.02,7]dodecane-4-carboxylate |
| SMILES | CCC(C)C(=O)OC1CC2CC1C1C3CC(CC3C(=O)OCC(C)(F)F)C21 |
| InChI | InChI=1S/C21H30F2O4/c1-4-10(2)19(24)27-16-8-12-7-15(16)18-13-5-11(17(12)18)6-14(13)20(25)26-9-21(3,22)23/h10-18H,4-9H2,1-3H3 |
| InChIKey | GNYCFFVDDOGAJJ-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.46 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cyclooctane_1', 'substructure': 'N/A'} |
|---|