C22H17NO6 — CID 58252776
[4-(3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl)phenyl] 3,5-dihydroxybenzoate (PubChem CID 58252776) has the molecular formula C22H17NO6 and a molecular weight of 391.38 g/mol. Its IUPAC name is [4-(3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl)phenyl] 3,5-dihydroxybenzoate.
| Compound Name | [4-(3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl)phenyl] 3,5-dihydroxybenzoate |
|---|---|
| PubChem CID | 58252776 |
| Molecular Formula | C22H17NO6 |
| Molecular Weight | 391.38 g/mol |
| Exact Mass | 391.11 |
| IUPAC Name | [4-(3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl)phenyl] 3,5-dihydroxybenzoate |
| SMILES | O=C(Oc1ccc(N2C(=O)C3C4C=CC(C4)C3C2=O)cc1)c1cc(O)cc(O)c1 |
| InChI | InChI=1S/C22H17NO6/c24-15-8-13(9-16(25)10-15)22(28)29-17-5-3-14(4-6-17)23-20(26)18-11-1-2-12(7-11)19(18)21(23)27/h1-6,8-12,18-19,24-25H,7H2 |
| InChIKey | WOPGZEXMOBROCX-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 104.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.38 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|