C23H19NO7 — CID 58252780
[4-(3,5-dioxo-4-azatricyclo[5.2.2.02,6]undec-8-en-4-yl)phenyl] 3,4,5-trihydroxybenzoate (PubChem CID 58252780) has the molecular formula C23H19NO7 and a molecular weight of 421.41 g/mol. Its IUPAC name is [4-(3,5-dioxo-4-azatricyclo[5.2.2.02,6]undec-8-en-4-yl)phenyl] 3,4,5-trihydroxybenzoate.
| Compound Name | [4-(3,5-dioxo-4-azatricyclo[5.2.2.02,6]undec-8-en-4-yl)phenyl] 3,4,5-trihydroxybenzoate |
|---|---|
| PubChem CID | 58252780 |
| Molecular Formula | C23H19NO7 |
| Molecular Weight | 421.41 g/mol |
| Exact Mass | 421.12 |
| IUPAC Name | [4-(3,5-dioxo-4-azatricyclo[5.2.2.02,6]undec-8-en-4-yl)phenyl] 3,4,5-trihydroxybenzoate |
| SMILES | O=C(Oc1ccc(N2C(=O)C3C4C=CC(CC4)C3C2=O)cc1)c1cc(O)c(O)c(O)c1 |
| InChI | InChI=1S/C23H19NO7/c25-16-9-13(10-17(26)20(16)27)23(30)31-15-7-5-14(6-8-15)24-21(28)18-11-1-2-12(4-3-11)19(18)22(24)29/h1-2,5-12,18-19,25-27H,3-4H2 |
| InChIKey | AKRSXIAFPZVWLV-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 124.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.41 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|