C39H50N4O10 — CID 58253020
(2,5-dioxopyrrolidin-1-yl) 1-[4-[bis[4-(dimethylamino)-2,6-dimethoxyphenyl]methyl]-3,5-dimethoxyphenyl]piperidine-4-carboxylate (PubChem CID 58253020) has the molecular formula C39H50N4O10 and a molecular weight of 734.85 g/mol. Its IUPAC name is (2,5-dioxopyrrolidin-1-yl) 1-[4-[bis[4-(dimethylamino)-2,6-dimethoxyphenyl]methyl]-3,5-dimethoxyphenyl]piperidine-4-carboxylate.
| Compound Name | (2,5-dioxopyrrolidin-1-yl) 1-[4-[bis[4-(dimethylamino)-2,6-dimethoxyphenyl]methyl]-3,5-dimethoxyphenyl]piperidine-4-carboxylate |
|---|---|
| PubChem CID | 58253020 |
| Molecular Formula | C39H50N4O10 |
| Molecular Weight | 734.85 g/mol |
| Exact Mass | 734.35 |
| IUPAC Name | (2,5-dioxopyrrolidin-1-yl) 1-[4-[bis[4-(dimethylamino)-2,6-dimethoxyphenyl]methyl]-3,5-dimethoxyphenyl]piperidine-4-carboxylate |
| SMILES | COc1cc(N(C)C)cc(OC)c1C(c1c(OC)cc(N(C)C)cc1OC)c1c(OC)cc(N2CCC(C(=O)ON3C(=O)CCC3=O)CC2)cc1OC |
| InChI | InChI=1S/C39H50N4O10/c1-40(2)24-17-27(47-5)35(28(18-24)48-6)38(36-29(49-7)19-25(41(3)4)20-30(36)50-8)37-31(51-9)21-26(22-32(37)52-10)42-15-13-23(14-16-42)39(46)53-43-33(44)11-12-34(43)45/h17-23,38H,11-16H2,1-10H3 |
| InChIKey | BQWXWWYXORTLSX-UHFFFAOYSA-N |
| XLogP | 4.87 |
| TPSA | 128.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 734.85 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'anil_di_alk_F(14)', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|