C10H16O9 — CID 58253139
2-[[(3R,4S,6R)-3,4,5-trihydroxy-6-methoxyoxan-2-yl]methyl]propanedioic acid (PubChem CID 58253139) has the molecular formula C10H16O9 and a molecular weight of 280.23 g/mol. Its IUPAC name is 2-[[(3R,4S,6R)-3,4,5-trihydroxy-6-methoxyoxan-2-yl]methyl]propanedioic acid.
| Compound Name | 2-[[(3R,4S,6R)-3,4,5-trihydroxy-6-methoxyoxan-2-yl]methyl]propanedioic acid |
|---|---|
| PubChem CID | 58253139 |
| Molecular Formula | C10H16O9 |
| Molecular Weight | 280.23 g/mol |
| Exact Mass | 280.08 |
| IUPAC Name | 2-[[(3R,4S,6R)-3,4,5-trihydroxy-6-methoxyoxan-2-yl]methyl]propanedioic acid |
| SMILES | CO[C@@H]1OC(CC(C(=O)O)C(=O)O)[C@H](O)[C@H](O)C1O |
| InChI | InChI=1S/C10H16O9/c1-18-10-7(13)6(12)5(11)4(19-10)2-3(8(14)15)9(16)17/h3-7,10-13H,2H2,1H3,(H,14,15)(H,16,17)/t4?,5-,6-,7?,10+/m0/s1 |
| InChIKey | JFNMARUYEAVMSV-RHOHLBHISA-N |
| XLogP | -2.38 |
| TPSA | 153.75 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.23 |
| LogP ≤ 5 | -2.38 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|