C24H29N5O4S — CID 58254033
(1R,4R)-5-[(2S)-3-[(3S,5S)-3-cyano-2-azabicyclo[3.1.0]hexan-2-yl]-2-methyl-3-oxopropyl]-3-oxo-2-[(1S)-5-(sulfinoamino)-2,3-dihydro-1H-inden-1-yl]-2,5-diazabicyclo[2.2.1]heptane (PubChem CID 58254033) has the molecular formula C24H29N5O4S and a molecular weight of 483.59 g/mol. Its IUPAC name is (1R,4R)-5-[(2S)-3-[(3S,5S)-3-cyano-2-azabicyclo[3.1.0]hexan-2-yl]-2-methyl-3-oxopropyl]-3-oxo-2-[(1S)-5-(sulfinoamino)-2,3-dihydro-1H-inden-1-yl]-2,5-diazabicyclo[2.2.1]heptane.
| Compound Name | (1R,4R)-5-[(2S)-3-[(3S,5S)-3-cyano-2-azabicyclo[3.1.0]hexan-2-yl]-2-methyl-3-oxopropyl]-3-oxo-2-[(1S)-5-(sulfinoamino)-2,3-dihydro-1H-inden-1-yl]-2,5-diazabicyclo[2.2.1]heptane |
|---|---|
| PubChem CID | 58254033 |
| Molecular Formula | C24H29N5O4S |
| Molecular Weight | 483.59 g/mol |
| Exact Mass | 483.19 |
| IUPAC Name | (1R,4R)-5-[(2S)-3-[(3S,5S)-3-cyano-2-azabicyclo[3.1.0]hexan-2-yl]-2-methyl-3-oxopropyl]-3-oxo-2-[(1S)-5-(sulfinoamino)-2,3-dihydro-1H-inden-1-yl]-2,5-diazabicyclo[2.2.1]heptane |
| SMILES | C[C@@H](CN1C[C@H]2C[C@@H]1C(=O)N2[C@H]1CCc2cc(NS(=O)O)ccc21)C(=O)N1C2C[C@H]2C[C@H]1C#N |
| InChI | InChI=1S/C24H29N5O4S/c1-13(23(30)28-17(10-25)7-15-8-21(15)28)11-27-12-18-9-22(27)24(31)29(18)20-5-2-14-6-16(26-34(32)33)3-4-19(14)20/h3-4,6,13,15,17-18,20-22,26H,2,5,7-9,11-12H2,1H3,(H,32,33)/t13-,15+,17-,18+,20-,21?,22+/m0/s1 |
| InChIKey | UVAIQTFTGMNMFJ-YRGSKIFOSA-N |
| XLogP | 1.66 |
| TPSA | 116.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.59 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|