About 3-[(5-amino-2-methyl-1,2,4-triazol-3-yl)sulfanyl]propane-1-thiol
3-[(5-amino-2-methyl-1,2,4-triazol-3-yl)sulfanyl]propane-1-thiol (PubChem CID 582541) has the molecular formula C6H12N4S2
and a molecular weight of 204.32 g/mol. Its IUPAC name is 3-[(5-amino-2-methyl-1,2,4-triazol-3-yl)sulfanyl]propane-1-thiol.
Molecular Properties
| Compound Name | 3-[(5-amino-2-methyl-1,2,4-triazol-3-yl)sulfanyl]propane-1-thiol |
| PubChem CID | 582541 |
| Molecular Formula | C6H12N4S2 |
| Molecular Weight | 204.32 g/mol |
| Exact Mass | 204.05 |
| IUPAC Name | 3-[(5-amino-2-methyl-1,2,4-triazol-3-yl)sulfanyl]propane-1-thiol |
| SMILES | Cn1nc(N)nc1SCCCS |
| InChI | InChI=1S/C6H12N4S2/c1-10-6(8-5(7)9-10)12-4-2-3-11/h11H,2-4H2,1H3,(H2,7,9) |
| InChIKey | ZSSDVDGCXHTXLJ-UHFFFAOYSA-N |
| XLogP | 0.81 |
| TPSA | 56.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 204.32 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze 3-[(5-amino-2-methyl-1,2,4-triazol-3-yl)sulfanyl]propane-1-thiol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[(5-amino-2-methyl-1,2,4-triazol-3-yl)sulfanyl]propane-1-thiol?
The IUPAC name of 3-[(5-amino-2-methyl-1,2,4-triazol-3-yl)sulfanyl]propane-1-thiol (CID 582541) is 3-[(5-amino-2-methyl-1,2,4-triazol-3-yl)sulfanyl]propane-1-thiol.
What is the SMILES notation for 3-[(5-amino-2-methyl-1,2,4-triazol-3-yl)sulfanyl]propane-1-thiol?
The canonical SMILES for 3-[(5-amino-2-methyl-1,2,4-triazol-3-yl)sulfanyl]propane-1-thiol is Cn1nc(N)nc1SCCCS.
What is the InChIKey of 3-[(5-amino-2-methyl-1,2,4-triazol-3-yl)sulfanyl]propane-1-thiol?
The InChIKey is ZSSDVDGCXHTXLJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H12N4S2/c1-10-6(8-5(7)9-10)12-4-2-3-11/h11H,2-4H2,1H3,(H2,7,9).
What are the key properties of 3-[(5-amino-2-methyl-1,2,4-triazol-3-yl)sulfanyl]propane-1-thiol?
3-[(5-amino-2-methyl-1,2,4-triazol-3-yl)sulfanyl]propane-1-thiol has a molecular weight of 204.32 g/mol, XLogP of 0.81, 4 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[(5-amino-2-methyl-1,2,4-triazol-3-yl)sulfanyl]propane-1-thiol is sourced from PubChem (CID 582541), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).