C28H34Cl2FN3O5 — CID 58254300
(2'R,3S,3'R,5'R)-6-chloro-3'-(3-chlorophenyl)-N-[(3S)-3,4-dihydroxybutyl]-5-fluoro-5'-(4-hydroxy-2,2-dimethylbutyl)-2-oxospiro[1H-indole-3,4'-pyrrolidine]-2'-carboxamide (PubChem CID 58254300) has the molecular formula C28H34Cl2FN3O5 and a molecular weight of 582.50 g/mol. Its IUPAC name is (2'R,3S,3'R,5'R)-6-chloro-3'-(3-chlorophenyl)-N-[(3S)-3,4-dihydroxybutyl]-5-fluoro-5'-(4-hydroxy-2,2-dimethylbutyl)-2-oxospiro[1H-indole-3,4'-pyrrolidine]-2'-carboxamide.
| Compound Name | (2'R,3S,3'R,5'R)-6-chloro-3'-(3-chlorophenyl)-N-[(3S)-3,4-dihydroxybutyl]-5-fluoro-5'-(4-hydroxy-2,2-dimethylbutyl)-2-oxospiro[1H-indole-3,4'-pyrrolidine]-2'-carboxamide |
|---|---|
| PubChem CID | 58254300 |
| Molecular Formula | C28H34Cl2FN3O5 |
| Molecular Weight | 582.50 g/mol |
| Exact Mass | 581.19 |
| IUPAC Name | (2'R,3S,3'R,5'R)-6-chloro-3'-(3-chlorophenyl)-N-[(3S)-3,4-dihydroxybutyl]-5-fluoro-5'-(4-hydroxy-2,2-dimethylbutyl)-2-oxospiro[1H-indole-3,4'-pyrrolidine]-2'-carboxamide |
| SMILES | CC(C)(CCO)C[C@H]1N[C@@H](C(=O)NCC[C@H](O)CO)[C@H](c2cccc(Cl)c2)[C@@]12C(=O)Nc1cc(Cl)c(F)cc12 |
| InChI | InChI=1S/C28H34Cl2FN3O5/c1-27(2,7-9-35)13-22-28(18-11-20(31)19(30)12-21(18)33-26(28)39)23(15-4-3-5-16(29)10-15)24(34-22)25(38)32-8-6-17(37)14-36/h3-5,10-12,17,22-24,34-37H,6-9,13-14H2,1-2H3,(H,32,38)(H,33,39)/t17-,22+,23-,24+,28-/m0/s1 |
| InChIKey | PCQRRVUHQZIMLN-FKUBJEGUSA-N |
| XLogP | 3.10 |
| TPSA | 130.92 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 582.50 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |