C17H15ClF4N2O2 — CID 58255211
(4S)-1-(6-chloro-5-fluoro-3-pyridinyl)-4-[5-(2,2,2-trifluoroethoxy)-2-pyridinyl]pentan-2-one (PubChem CID 58255211) has the molecular formula C17H15ClF4N2O2 and a molecular weight of 390.76 g/mol. Its IUPAC name is (4S)-1-(6-chloro-5-fluoro-3-pyridinyl)-4-[5-(2,2,2-trifluoroethoxy)-2-pyridinyl]pentan-2-one.
| Compound Name | (4S)-1-(6-chloro-5-fluoro-3-pyridinyl)-4-[5-(2,2,2-trifluoroethoxy)-2-pyridinyl]pentan-2-one |
|---|---|
| PubChem CID | 58255211 |
| Molecular Formula | C17H15ClF4N2O2 |
| Molecular Weight | 390.76 g/mol |
| Exact Mass | 390.08 |
| IUPAC Name | (4S)-1-(6-chloro-5-fluoro-3-pyridinyl)-4-[5-(2,2,2-trifluoroethoxy)-2-pyridinyl]pentan-2-one |
| SMILES | C[C@@H](CC(=O)Cc1cnc(Cl)c(F)c1)c1ccc(OCC(F)(F)F)cn1 |
| InChI | InChI=1S/C17H15ClF4N2O2/c1-10(4-12(25)5-11-6-14(19)16(18)24-7-11)15-3-2-13(8-23-15)26-9-17(20,21)22/h2-3,6-8,10H,4-5,9H2,1H3/t10-/m0/s1 |
| InChIKey | KHDLDSYCBWHFHN-JTQLQIEISA-N |
| XLogP | 4.52 |
| TPSA | 52.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.76 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|