About (4S)-5,5,5-trifluoro-4-(5-hydroxy-2-pyridinyl)-1-(4-thiophen-3-ylphenyl)pentan-2-one
(4S)-5,5,5-trifluoro-4-(5-hydroxy-2-pyridinyl)-1-(4-thiophen-3-ylphenyl)pentan-2-one (PubChem CID 58255221) has the molecular formula C20H16F3NO2S
and a molecular weight of 391.41 g/mol. Its IUPAC name is (4S)-5,5,5-trifluoro-4-(5-hydroxy-2-pyridinyl)-1-(4-thiophen-3-ylphenyl)pentan-2-one.
Molecular Properties
| Compound Name | (4S)-5,5,5-trifluoro-4-(5-hydroxy-2-pyridinyl)-1-(4-thiophen-3-ylphenyl)pentan-2-one |
| PubChem CID | 58255221 |
| Molecular Formula | C20H16F3NO2S |
| Molecular Weight | 391.41 g/mol |
| Exact Mass | 391.09 |
| IUPAC Name | (4S)-5,5,5-trifluoro-4-(5-hydroxy-2-pyridinyl)-1-(4-thiophen-3-ylphenyl)pentan-2-one |
| SMILES | O=C(Cc1ccc(-c2ccsc2)cc1)C[C@@H](c1ccc(O)cn1)C(F)(F)F |
| InChI | InChI=1S/C20H16F3NO2S/c21-20(22,23)18(19-6-5-16(25)11-24-19)10-17(26)9-13-1-3-14(4-2-13)15-7-8-27-12-15/h1-8,11-12,18,25H,9-10H2/t18-/m0/s1 |
| InChIKey | LHCQFSPPGCJZDF-SFHVURJKSA-N |
| XLogP | 5.36 |
| TPSA | 50.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 391.41 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (4S)-5,5,5-trifluoro-4-(5-hydroxy-2-pyridinyl)-1-(4-thiophen-3-ylphenyl)pentan-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4S)-5,5,5-trifluoro-4-(5-hydroxy-2-pyridinyl)-1-(4-thiophen-3-ylphenyl)pentan-2-one?
The IUPAC name of (4S)-5,5,5-trifluoro-4-(5-hydroxy-2-pyridinyl)-1-(4-thiophen-3-ylphenyl)pentan-2-one (CID 58255221) is (4S)-5,5,5-trifluoro-4-(5-hydroxy-2-pyridinyl)-1-(4-thiophen-3-ylphenyl)pentan-2-one.
What is the SMILES notation for (4S)-5,5,5-trifluoro-4-(5-hydroxy-2-pyridinyl)-1-(4-thiophen-3-ylphenyl)pentan-2-one?
The canonical SMILES for (4S)-5,5,5-trifluoro-4-(5-hydroxy-2-pyridinyl)-1-(4-thiophen-3-ylphenyl)pentan-2-one is O=C(Cc1ccc(-c2ccsc2)cc1)C[C@@H](c1ccc(O)cn1)C(F)(F)F.
What is the InChIKey of (4S)-5,5,5-trifluoro-4-(5-hydroxy-2-pyridinyl)-1-(4-thiophen-3-ylphenyl)pentan-2-one?
The InChIKey is LHCQFSPPGCJZDF-SFHVURJKSA-N. The full InChI is InChI=1S/C20H16F3NO2S/c21-20(22,23)18(19-6-5-16(25)11-24-19)10-17(26)9-13-1-3-14(4-2-13)15-7-8-27-12-15/h1-8,11-12,18,25H,9-10H2/t18-/m0/s1.
What are the key properties of (4S)-5,5,5-trifluoro-4-(5-hydroxy-2-pyridinyl)-1-(4-thiophen-3-ylphenyl)pentan-2-one?
(4S)-5,5,5-trifluoro-4-(5-hydroxy-2-pyridinyl)-1-(4-thiophen-3-ylphenyl)pentan-2-one has a molecular weight of 391.41 g/mol, XLogP of 5.36, 6 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (4S)-5,5,5-trifluoro-4-(5-hydroxy-2-pyridinyl)-1-(4-thiophen-3-ylphenyl)pentan-2-one is sourced from PubChem (CID 58255221), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).