About methyl 2-cyanobenzoate
methyl 2-cyanobenzoate (PubChem CID 582554) has the molecular formula C9H7NO2
and a molecular weight of 161.16 g/mol. Its IUPAC name is methyl 2-cyanobenzoate.
Molecular Properties
| Compound Name | methyl 2-cyanobenzoate |
| PubChem CID | 582554 |
| Molecular Formula | C9H7NO2 |
| Molecular Weight | 161.16 g/mol |
| Exact Mass | 161.05 |
| IUPAC Name | methyl 2-cyanobenzoate |
| SMILES | COC(=O)c1ccccc1C#N |
| InChI | InChI=1S/C9H7NO2/c1-12-9(11)8-5-3-2-4-7(8)6-10/h2-5H,1H3 |
| InChIKey | RAMPDACRJWTXEV-UHFFFAOYSA-N |
| XLogP | 1.34 |
| TPSA | 50.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 161.16 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze methyl 2-cyanobenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 2-cyanobenzoate?
The IUPAC name of methyl 2-cyanobenzoate (CID 582554) is methyl 2-cyanobenzoate.
What is the SMILES notation for methyl 2-cyanobenzoate?
The canonical SMILES for methyl 2-cyanobenzoate is COC(=O)c1ccccc1C#N.
What is the InChIKey of methyl 2-cyanobenzoate?
The InChIKey is RAMPDACRJWTXEV-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H7NO2/c1-12-9(11)8-5-3-2-4-7(8)6-10/h2-5H,1H3.
What are the key properties of methyl 2-cyanobenzoate?
methyl 2-cyanobenzoate has a molecular weight of 161.16 g/mol, XLogP of 1.34, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-cyanobenzoate is sourced from PubChem (CID 582554), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).