C13H20N2O3W — CID 58256386
2-aminoethanol;ethyl N-(4-ethylphenyl)carbamate;tungsten(2+) (PubChem CID 58256386) has the molecular formula C13H20N2O3W and a molecular weight of 436.15 g/mol. Its IUPAC name is 2-aminoethanol;ethyl N-(4-ethylphenyl)carbamate;tungsten(2+).
| Compound Name | 2-aminoethanol;ethyl N-(4-ethylphenyl)carbamate;tungsten(2+) |
|---|---|
| PubChem CID | 58256386 |
| Molecular Formula | C13H20N2O3W |
| Molecular Weight | 436.15 g/mol |
| Exact Mass | 436.10 |
| IUPAC Name | 2-aminoethanol;ethyl N-(4-ethylphenyl)carbamate;tungsten(2+) |
| SMILES | N[CH-]CO.[CH2-]Cc1ccc(NC(=O)OCC)cc1.[W+2] |
| InChI | InChI=1S/C11H14NO2.C2H6NO.W/c1-3-9-5-7-10(8-6-9)12-11(13)14-4-2;3-1-2-4;/h5-8H,1,3-4H2,2H3,(H,12,13);1,4H,2-3H2;/q2*-1;+2 |
| InChIKey | LYMXBOHPJSUFKI-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 84.58 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.15 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|