C14H23NO5 — CID 58256818
tert-butyl (3R,3aS,6R,6aR)-3-acetyloxy-6-methyl-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]pyrrole-4-carboxylate (PubChem CID 58256818) has the molecular formula C14H23NO5 and a molecular weight of 285.34 g/mol. Its IUPAC name is tert-butyl (3R,3aS,6R,6aR)-3-acetyloxy-6-methyl-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]pyrrole-4-carboxylate.
| Compound Name | tert-butyl (3R,3aS,6R,6aR)-3-acetyloxy-6-methyl-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]pyrrole-4-carboxylate |
|---|---|
| PubChem CID | 58256818 |
| Molecular Formula | C14H23NO5 |
| Molecular Weight | 285.34 g/mol |
| Exact Mass | 285.16 |
| IUPAC Name | tert-butyl (3R,3aS,6R,6aR)-3-acetyloxy-6-methyl-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]pyrrole-4-carboxylate |
| SMILES | CC(=O)O[C@H]1CO[C@H]2[C@@H]1N(C(=O)OC(C)(C)C)C[C@H]2C |
| InChI | InChI=1S/C14H23NO5/c1-8-6-15(13(17)20-14(3,4)5)11-10(19-9(2)16)7-18-12(8)11/h8,10-12H,6-7H2,1-5H3/t8-,10+,11-,12-/m1/s1 |
| InChIKey | WTDSWSLJIFCFNE-SASUGWTJSA-N |
| XLogP | 1.57 |
| TPSA | 65.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.34 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |