C31H36N2O2 — CID 58257286
1-[(2-benzylphenyl)methyl]-3-[2,6-di(propan-2-yl)phenyl]-5,5-dimethylimidazolidine-2,4-dione (PubChem CID 58257286) has the molecular formula C31H36N2O2 and a molecular weight of 468.64 g/mol. Its IUPAC name is 1-[(2-benzylphenyl)methyl]-3-[2,6-di(propan-2-yl)phenyl]-5,5-dimethylimidazolidine-2,4-dione.
| Compound Name | 1-[(2-benzylphenyl)methyl]-3-[2,6-di(propan-2-yl)phenyl]-5,5-dimethylimidazolidine-2,4-dione |
|---|---|
| PubChem CID | 58257286 |
| Molecular Formula | C31H36N2O2 |
| Molecular Weight | 468.64 g/mol |
| Exact Mass | 468.28 |
| IUPAC Name | 1-[(2-benzylphenyl)methyl]-3-[2,6-di(propan-2-yl)phenyl]-5,5-dimethylimidazolidine-2,4-dione |
| SMILES | CC(C)c1cccc(C(C)C)c1N1C(=O)N(Cc2ccccc2Cc2ccccc2)C(C)(C)C1=O |
| InChI | InChI=1S/C31H36N2O2/c1-21(2)26-17-12-18-27(22(3)4)28(26)33-29(34)31(5,6)32(30(33)35)20-25-16-11-10-15-24(25)19-23-13-8-7-9-14-23/h7-18,21-22H,19-20H2,1-6H3 |
| InChIKey | YRPDFZKYKBYQJF-UHFFFAOYSA-N |
| XLogP | 7.27 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.64 |
| LogP ≤ 5 | 7.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|