About 6-ethyl-3H-pyridin-3-ide;propane;yttrium
6-ethyl-3H-pyridin-3-ide;propane;yttrium (PubChem CID 58257500) has the molecular formula C10H15NY-2
and a molecular weight of 238.14 g/mol. Its IUPAC name is 6-ethyl-3H-pyridin-3-ide;propane;yttrium.
Molecular Properties
| Compound Name | 6-ethyl-3H-pyridin-3-ide;propane;yttrium |
| PubChem CID | 58257500 |
| Molecular Formula | C10H15NY-2 |
| Molecular Weight | 238.14 g/mol |
| Exact Mass | 238.03 |
| IUPAC Name | 6-ethyl-3H-pyridin-3-ide;propane;yttrium |
| SMILES | CCc1cc[c-]cn1.[CH2-]CC.[Y] |
| InChI | InChI=1S/C7H8N.C3H7.Y/c1-2-7-5-3-4-6-8-7;1-3-2;/h3,5-6H,2H2,1H3;1,3H2,2H3;/q2*-1; |
| InChIKey | APAMHRJGIQDAIT-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 238.14 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze 6-ethyl-3H-pyridin-3-ide;propane;yttrium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-ethyl-3H-pyridin-3-ide;propane;yttrium?
The IUPAC name of 6-ethyl-3H-pyridin-3-ide;propane;yttrium (CID 58257500) is 6-ethyl-3H-pyridin-3-ide;propane;yttrium.
What is the SMILES notation for 6-ethyl-3H-pyridin-3-ide;propane;yttrium?
The canonical SMILES for 6-ethyl-3H-pyridin-3-ide;propane;yttrium is CCc1cc[c-]cn1.[CH2-]CC.[Y].
What is the InChIKey of 6-ethyl-3H-pyridin-3-ide;propane;yttrium?
The InChIKey is APAMHRJGIQDAIT-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H8N.C3H7.Y/c1-2-7-5-3-4-6-8-7;1-3-2;/h3,5-6H,2H2,1H3;1,3H2,2H3;/q2*-1;.
What are the key properties of 6-ethyl-3H-pyridin-3-ide;propane;yttrium?
6-ethyl-3H-pyridin-3-ide;propane;yttrium has a molecular weight of 238.14 g/mol, XLogP of 2.67, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 6-ethyl-3H-pyridin-3-ide;propane;yttrium is sourced from PubChem (CID 58257500), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).