C21H19F3N2O3S — CID 58258769
9-methyl-5-[3-(trifluoromethyl)phenyl]sulfonyl-9,15-diazatetracyclo[10.2.1.02,10.03,8]pentadeca-2(10),3(8),4,6-tetraen-7-ol (PubChem CID 58258769) has the molecular formula C21H19F3N2O3S and a molecular weight of 436.46 g/mol. Its IUPAC name is 9-methyl-5-[3-(trifluoromethyl)phenyl]sulfonyl-9,15-diazatetracyclo[10.2.1.02,10.03,8]pentadeca-2(10),3(8),4,6-tetraen-7-ol.
| Compound Name | 9-methyl-5-[3-(trifluoromethyl)phenyl]sulfonyl-9,15-diazatetracyclo[10.2.1.02,10.03,8]pentadeca-2(10),3(8),4,6-tetraen-7-ol |
|---|---|
| PubChem CID | 58258769 |
| Molecular Formula | C21H19F3N2O3S |
| Molecular Weight | 436.46 g/mol |
| Exact Mass | 436.11 |
| IUPAC Name | 9-methyl-5-[3-(trifluoromethyl)phenyl]sulfonyl-9,15-diazatetracyclo[10.2.1.02,10.03,8]pentadeca-2(10),3(8),4,6-tetraen-7-ol |
| SMILES | Cn1c2c(c3cc(S(=O)(=O)c4cccc(C(F)(F)F)c4)cc(O)c31)C1CCC(C2)N1 |
| InChI | InChI=1S/C21H19F3N2O3S/c1-26-17-8-12-5-6-16(25-12)19(17)15-9-14(10-18(27)20(15)26)30(28,29)13-4-2-3-11(7-13)21(22,23)24/h2-4,7,9-10,12,16,25,27H,5-6,8H2,1H3 |
| InChIKey | KIQNADMCQROKAV-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 71.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.46 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|